| 00:10.49 | *** join/#sporewiki ZF102 (4933de11@gateway/web/freenode/ip.73.51.222.17) |
| 00:12.35 | ZF102 | I hate when my internet cuts out. |
| 00:57.57 | *** join/#sporewiki infobot (ibot@rikers.org) |
| 00:57.57 | *** topic/#sporewiki is SporeWiki! http://spore.wikia.com || Logs: http://ibot.rikers.org/%23sporewiki/ || Collaborative Universes: Sci-Fi http://tinyurl.com/3ddvp7q Fantasy http://tinyurl.com/p9qau7l || Titanpad: https://titanpad.com/ || Offtopic chat: #sporewiki-offtopic |
| 00:57.57 | *** mode/#sporewiki [+v infobot] by ChanServ |
| 01:02.52 | ZF102 | Well, goodnight everyone. |
| 02:16.44 | *** join/#sporewiki Methanogen (79dacdc7@gateway/web/freenode/ip.121.218.205.199) |
| 02:16.49 | Methanogen | Hello |
| 02:18.36 | DrodoEmpire | Hi |
| 02:18.40 | DrodoEmpire | How're you? |
| 02:20.26 | Methanogen | Hi drodo, I'm good |
| 02:20.39 | Methanogen | I have the had work of creating actual empires out my races ahead of me now |
| 02:20.45 | Methanogen | *the hard |
| 02:21.00 | Methanogen | How are you? |
| 02:21.25 | DrodoEmpire | Aye I'm good |
| 02:21.41 | DrodoEmpire | I'm happy to help you if you wish |
| 02:21.53 | Methanogen | Since I'm getting to work making societies I have a few questions |
| 02:21.58 | Methanogen | Thanks, I appreciate any help |
| 02:22.31 | DrodoEmpire | Alright no problem |
| 02:22.40 | DrodoEmpire | I miiight be able to answer them effectively |
| 02:23.05 | Methanogen | My first question is this: in general, what's the current state of the universe? Any massive wars or such happening now or is it fairly tranquil? |
| 02:23.21 | DrodoEmpire | Hm |
| 02:23.52 | DrodoEmpire | Well, there is a large war, mostly in Cyrannus and spilling into the Quadrant Galaxies, between the Galactic Empire of Cyrannus and the New Cyrannian republic and its close allies |
| 02:24.13 | DrodoEmpire | If your fictions are in the Milky Way and Andromeda, they aren't terribly likely to affect you |
| 02:24.20 | Methanogen | Ah so there is a large war, although not near wehere my stuff is |
| 02:24.26 | DrodoEmpire | Sorta yeah |
| 02:24.30 | Methanogen | They're in the Milky Way so far |
| 02:24.50 | DrodoEmpire | MK, Andromeda, and those galaxies are part of a cluster called "Xonexi", while Cyrannus and Quadrants are in "Cyrandia" |
| 02:25.14 | Methanogen | I see so we have intergalactic clusters |
| 02:25.20 | DrodoEmpire | Xonexi has been peaceful for the past (in-universe) decade or so after the Great Xonexian Schism, which forged a new, more stable, fairer political order |
| 02:25.39 | Methanogen | So it's rather peaceful for now |
| 02:25.55 | Methanogen | I'm sure somebody will cause a giant war again at some point though |
| 02:26.18 | DrodoEmpire | Essentially you have the great powers of France, the Draconid Imperium, and the Delpha Coalition of Planets alongside other major powers such as the Drodo Empire keeping the peace besides some minor conflicts and incidents in order to keep the whole thing afloat |
| 02:26.19 | DrodoEmpire | Maybe |
| 02:26.31 | DrodoEmpire | Its a good, highly-interconnected time |
| 02:26.48 | Methanogen | And probably a million smaller insignificant races such as mine currently |
| 02:27.00 | DrodoEmpire | Not so fast with "insignificant", but, yeah |
| 02:28.14 | Methanogen | I'm guessing my races won't have a massively impact on the Galaxy just yet |
| 02:28.19 | Methanogen | Although I could be wrong who knows |
| 02:28.20 | DrodoEmpire | Not yet, nope |
| 02:28.25 | DrodoEmpire | But soon enough |
| 02:28.50 | DrodoEmpire | I'd be happy to collab with you once you have your fiction mostly-ready |
| 02:29.16 | Methanogen | One of my empires is so far pretty standard for a small empire the other has an advanced tech for age and size thing going on |
| 02:29.23 | DrodoEmpire | Hmm okay |
| 02:29.25 | DrodoEmpire | Links? |
| 02:29.29 | Methanogen | Yeah I've got like half a paragraph on one of these so far |
| 02:30.03 | Methanogen | Not much point linking them, I've just got an info box on one and that's it for it |
| 02:30.10 | Methanogen | The other gets one paragraph |
| 02:30.13 | Methanogen | Lots of work to be done |
| 02:30.46 | DrodoEmpire | I'd still like to see, if you don't mind |
| 02:30.58 | DrodoEmpire | Just like to have it in front of me out of habit |
| 02:31.07 | Methanogen | Very well, I'll link it but it's nowhere near ready for use |
| 02:31.53 | DrodoEmpire | That |
| 02:31.57 | DrodoEmpire | *That's alright |
| 02:32.59 | Methanogen | Behold, an infobox: http://spore.wikia.com/wiki/Fiction:Yorchi_Union |
| 02:33.15 | Methanogen | I don't know the standard level of starting amount of planets and such so that could be huge or tiny or anything really |
| 02:33.40 | DrodoEmpire | Nations often have system counts in the thousands or tens of thousands |
| 02:33.49 | Methanogen | This one gets a single paragraph http://spore.wikia.com/wiki/Fiction:Eriaroon_Eugenic_Republic |
| 02:33.53 | Methanogen | That's quite a lot |
| 02:34.00 | DrodoEmpire | Small nations only have a couple thousand or less |
| 02:34.08 | DrodoEmpire | Indeed, but a small start's fine too |
| 02:34.16 | Methanogen | I should probably increase the numbers just a bit |
| 02:34.25 | DrodoEmpire | A smidge, perhaps |
| 02:34.30 | Methanogen | Although both of these will probably be rapidly expanding anyway |
| 02:34.31 | DrodoEmpire | Do the same for the population as well |
| 02:34.59 | Methanogen | Alright I shall make sure to increase system count and population |
| 02:35.38 | Methanogen | Question btw: what to you is the most important part of an empire? |
| 02:35.39 | DrodoEmpire | kk |
| 02:35.46 | DrodoEmpire | Oh dear |
| 02:35.49 | DrodoEmpire | Tough one |
| 02:36.08 | DrodoEmpire | If you mean in terms of to have down on the page, then all I can say there is do history last |
| 02:36.19 | Methanogen | Because it takes forever and always changes? |
| 02:36.25 | DrodoEmpire | Because that'll take up a huge amount of space and not come up often |
| 02:36.27 | DrodoEmpire | Exactly |
| 02:36.47 | DrodoEmpire | Focus on government, society/culture, economy, and military in roughly that order |
| 02:37.03 | Methanogen | Got it that makes sense |
| 02:37.27 | Methanogen | One government is a stratocracy so nothing too special so farc |
| 02:37.31 | DrodoEmpire | Ahh |
| 02:37.31 | Methanogen | *far |
| 02:38.00 | Methanogen | The other is a kind of theocratic technocratic oligarchic eugenic state |
| 02:38.16 | DrodoEmpire | Right, right |
| 02:38.22 | DrodoEmpire | I was reading on that, interesting |
| 02:38.57 | Methanogen | Yeah I have about one paragraph on it in the actual page and a brief mention of the religious part in the Eriaroon page |
| 02:39.08 | DrodoEmpire | Right |
| 02:39.50 | Methanogen | They have a somewhat unique (as far as I'm aware anyway) belief system, I'll make sure to detail that in culture |
| 02:40.03 | DrodoEmpire | Yeah, definitely flesh that out |
| 02:40.10 | DrodoEmpire | I was intrigued by what was there |
| 02:40.45 | Methanogen | That's good, I'm glad it's an interesting premise |
| 02:41.20 | Methanogen | They've only recently discovered other planets and stars and even the very sky are things due to living in water near hydrothermal vents all their history |
| 02:41.30 | Methanogen | So they have a rather exotic outlook on the universe |
| 02:43.00 | DrodoEmpire | Hmm okay interesting |
| 02:43.10 | DrodoEmpire | It could make first contact rather interesting overall |
| 02:43.20 | Methanogen | Yes it could |
| 02:44.16 | Methanogen | Most species probably haven't really encountered creatures like that before, at least spacefaring intelligent ones |
| 02:44.27 | DrodoEmpire | They'd certainly be exotic |
| 02:45.08 | Methanogen | Yes so it will hopefully make for some interesting situations |
| 02:45.11 | DrodoEmpire | ^ |
| 02:45.32 | Methanogen | Which in the end is the goal of my fiction |
| 02:45.42 | DrodoEmpire | Yeah an FC scenario could be really cool with the Drodo, as I have a few ideas for Drodo expansion |
| 02:45.59 | DrodoEmpire | And a new Drodo culture, or maybe expand more on an existing one |
| 02:46.00 | Methanogen | You do? What are they? |
| 02:46.35 | Methanogen | My goal for now is just creating this stuff to begin. Expansion comes a bit later |
| 02:47.38 | DrodoEmpire | Yeah, so essentially I think I might use a new ethnicity for the FC scenario (if you're up to it). Essentially, they'd be the Drodo answer to "mountain folk" |
| 02:47.57 | DrodoEmpire | So a Drodo equivalent to Armenians, or Greeks during the Ottoman period |
| 02:48.00 | Methanogen | I sort of see |
| 02:48.21 | DrodoEmpire | I guess before I continue I should note that the Drodo are -pretty- traditionalist, and many are rural-living |
| 02:48.32 | Methanogen | I'm interesting in making a first contact scenario, though of course I have to actually finish my stuff |
| 02:48.34 | DrodoEmpire | Hence why so many continue a fairly-traditional way of life |
| 02:48.36 | DrodoEmpire | Yeah |
| 02:49.10 | DrodoEmpire | Anyway, what I'm thinking is that this group of people essentially live on the mountainside and traditionally make a living off herding-- in this case, herding on a vast, industrial scale |
| 02:49.21 | DrodoEmpire | Picture herds of billions, making their way across worlds |
| 02:49.30 | Methanogen | So quite a lot of then |
| 02:49.33 | Methanogen | Yeah that's a lot |
| 02:49.33 | DrodoEmpire | Yeah |
| 02:50.18 | DrodoEmpire | I figure they'd get around to one of your fictions' space by buying the patch of space and settling there to maybe fulfill a Drodo Imperial government contract for meat, or whatever e;se |
| 02:50.19 | Methanogen | And they'd be the people to make first contact with the Eriaroons? |
| 02:50.26 | Methanogen | Ah |
| 02:50.29 | DrodoEmpire | Or the Yorchi, whichever |
| 02:50.53 | Methanogen | Neither would live on the kind of planet they'd be looking at for life probably |
| 02:51.28 | Methanogen | Eriaroon is probably a bit more interesting to me currently so I'll probably go with that |
| 02:51.32 | DrodoEmpire | Anyway, the presence of a few billion herdspeople who live in the mountains and leave entire vast patches of land bare with herds would... probably raise eyebrows |
| 02:51.47 | DrodoEmpire | *mountains of many worlds near or in their space by accident |
| 02:51.57 | Methanogen | True it would |
| 02:52.05 | DrodoEmpire | Could lead to some serious misunderstandings |
| 02:52.42 | Methanogen | Yes it could |
| 02:54.04 | DrodoEmpire | Its an idea, could go with something different for sure |
| 02:54.29 | Methanogen | Eriaroons would honestly be shocked just by life living out of water since they have no acquaintance with such life |
| 02:54.36 | DrodoEmpire | I have a whole repetoire of cultures I could expand on via storytelling, and bouncing our fictions off of one another |
| 02:54.40 | DrodoEmpire | Huh |
| 02:54.53 | DrodoEmpire | So I suppose this scenario would be a bit of a trial by fire, so to speak >.< |
| 02:55.09 | DrodoEmpire | "Never saw land-based life before? Well here's BILLIONS OF THEM" |
| 02:55.10 | Methanogen | True i suppose |
| 02:55.15 | Methanogen | Yeah... |
| 02:55.54 | Methanogen | and they have a giant empire as well or at least a large one |
| 02:56.12 | DrodoEmpire | Yeah |
| 02:56.21 | DrodoEmpire | Though, the Drodo aren't ones to pick fights |
| 02:56.29 | DrodoEmpire | The herders, on the other hand |
| 02:56.45 | DrodoEmpire | Well, many Drodo peoples maintain a -very- strong martial tradition >.< |
| 02:57.21 | Methanogen | Yorchi have a lot more of a martial tradition than Eriaroons- the latter has had a lot of wars as well of course |
| 02:57.34 | DrodoEmpire | -That- could be an interesting combo |
| 02:57.47 | DrodoEmpire | Drodo and the Yorchi getting into spats |
| 02:58.25 | Methanogen | Yes it could |
| 02:59.20 | Methanogen | Currently neither of my races has encountered life, just to make their respective first contacts more interesting really |
| 03:00.00 | DrodoEmpire | ^ |
| 03:00.08 | Methanogen | They'd both probably be looking in a bad place for most of the universes life anyway |
| 03:00.11 | DrodoEmpire | Like any life at all or intelligent life? |
| 03:00.46 | Methanogen | Yorchi would be looking for a cross between earth and Venus and Eriaroon would basically be loooking for Europa like moons |
| 03:00.47 | Methanogen | Hmmmm |
| 03:00.53 | Methanogen | I'm not sure |
| 03:01.00 | Methanogen | I'll have to decide on that one |
| 03:01.38 | Methanogen | No life makes me it an even more unique occurrence but it's kind of unlikely probably |
| 03:01.50 | DrodoEmpire | Eh yeah |
| 03:02.07 | DrodoEmpire | Its possible they've encountered some alien flora or animals |
| 03:02.27 | Methanogen | True I'll probably go that route |
| 03:02.51 | Methanogen | But intelligent life is far more unique in the universe than a few animals and plants |
| 03:03.01 | DrodoEmpire | ^ |
| 03:03.06 | DrodoEmpire | Far more complex, yeah |
| 03:03.31 | DrodoEmpire | We'd really have to make that initial contact something special, as it'd be something cool to see |
| 03:03.44 | Methanogen | Yes agreed |
| 03:04.31 | Methanogen | The two species would be completely alien to each other |
| 03:04.53 | DrodoEmpire | Maybe emphasise the fact that they have no real way of communicating to eachother besides posturing and the like-- I can picture some Yorchi patrol or scouting party encountering a Drodo herdsman on (robo)horseback and neither of them knowing quite how to react |
| 03:05.19 | DrodoEmpire | Or stumbling across a landed Drodo colony ship, or something like that |
| 03:05.26 | Methanogen | Yes true, they'd have trouble communicating for sure |
| 03:07.13 | Methanogen | I'll probably go for Yorchi for this, they have fewer logistical issues with this sort of thing (they can walk and have hands) plus Eriaroon will take longer to get finished anyway most likely |
| 03:07.41 | DrodoEmpire | Yeah fair enough |
| 03:07.54 | Methanogen | Actually, what do Drodo look like? I actually have no clue |
| 03:09.08 | DrodoEmpire | Ah |
| 03:09.13 | Methanogen | I've kind of been assuming they're humanoid this whole time for all I know their giant crystal space worms |
| 03:09.33 | DrodoEmpire | Well, they're humanoid yeah, but I'll need a minute to drudge up some old (rough) sketches I did |
| 03:09.39 | DrodoEmpire | And a spore model |
| 03:09.50 | Methanogen | Ah |
| 03:10.06 | Methanogen | I take it your focus is more on society than biology |
| 03:10.14 | DrodoEmpire | Yeah for sure |
| 03:10.25 | DrodoEmpire | http://vignette4.wikia.nocookie.net/spore/images/a/aa/Drodo.png/revision/latest?cb=20140607001547 - here's a spore model |
| 03:11.03 | Methanogen | They kind of remind me of humanoids with mosquito heads |
| 03:11.44 | DrodoEmpire | Eh, not quite |
| 03:12.01 | DrodoEmpire | Their 'proboscis' isn't really a proboscis, and I know that's confusing |
| 03:12.26 | Methanogen | Yorchi are kind of like humanoid insectoid-crustaceans innterms of anatomy, and Eriaroons are like intelligent giant starfish-octopi things |
| 03:12.30 | Methanogen | What is it? |
| 03:12.52 | DrodoEmpire | Essentially, its a pretty "humanoid" mouth, with two horizontal rows of teeth (made from cartilage) attached to a section of extended, reinforced esophagus 15-20 cm long |
| 03:13.14 | Methanogen | It just extends outward a bit? |
| 03:13.20 | DrodoEmpire | Yeah basically |
| 03:13.38 | DrodoEmpire | https://i.gyazo.com/31a605844422faeccc33a3a9293029c8.png - sketch of a Drodo cavalryman, from the colonies |
| 03:13.47 | DrodoEmpire | https://i.gyazo.com/6ed076baff1ef884962b71a6a1cf4c22.png - bottom detail |
| 03:13.57 | Methanogen | Ah, you have cavalry? |
| 03:14.00 | DrodoEmpire | https://i.gyazo.com/6ce6fe37564288a7e4c64b0a8c3dd61d.png -top |
| 03:14.13 | DrodoEmpire | Yeah, its an expression of their martial tradition and, well, traditionalism |
| 03:14.37 | Methanogen | True it is |
| 03:14.52 | DrodoEmpire | Essentially the horses themselves are robotic and capable of galloping at about the speed of a sportscar at full-tilt, are heavily-armoured, and have shielding that can deflect a full magazine of rifle ammo |
| 03:15.16 | Methanogen | Eriaroon can't really use cavalry...they don't have a very good body structure for mounting things and they live underwater |
| 03:15.23 | Methanogen | Sounds like pretty powerful cavalry then |
| 03:15.43 | DrodoEmpire | Their weapons are vibroblades capable of slashing through vehicle armour, rifles, pistols, anti-materiel rifles, and power-lances that can cripple tanks |
| 03:15.52 | DrodoEmpire | Different cav have different equipment and roles |
| 03:15.58 | DrodoEmpire | Yeah they are, for sure |
| 03:16.05 | Methanogen | I haven't decided on my species weapons yet |
| 03:16.11 | DrodoEmpire | I can help witht hat |
| 03:16.18 | DrodoEmpire | Out of everything -that's- my 'specialty' |
| 03:16.43 | Methanogen | Apart from sulfuric acid guns which are basically Yorchi water guns so not military grade |
| 03:16.49 | DrodoEmpire | Right hur |
| 03:17.09 | DrodoEmpire | A couple other sketches I did a while ago - https://i.gyazo.com/5eb322b8e729367abaeb81faa1d4234c.png - a Drodo man, possibly an IDMP officer, in more plain clothes |
| 03:17.31 | Methanogen | Here's a weapon question for you |
| 03:18.04 | DrodoEmpire | Yep? |
| 03:18.35 | Methanogen | The Yorchi home planet has around 40 atm of atmospheric pressure (compared to earths 1). If they used a gun designed for that on an earth-like world, would it be more powerful, less powerful or useless |
| 03:18.50 | DrodoEmpire | ...Ahh |
| 03:18.55 | DrodoEmpire | That's a physics question |
| 03:19.02 | Methanogen | True |
| 03:19.03 | DrodoEmpire | I'm no good at the physics ?/> |
| 03:19.05 | DrodoEmpire | *>.< |
| 03:19.16 | DrodoEmpire | I'm better with like the actual application |
| 03:19.25 | Methanogen | That's fine, thought it was worth asking |
| 03:19.37 | DrodoEmpire | Nah its cool |
| 03:19.37 | Methanogen | I'm bad at physics too, chemistry is more my thing when it comes to science |
| 03:19.46 | DrodoEmpire | We have a few physics people around |
| 03:20.19 | Methanogen | I'll have to ask one of them then |
| 03:20.29 | Methanogen | Another, application based weapons question |
| 03:20.37 | DrodoEmpire | Okay? |
| 03:21.06 | Methanogen | In terms of what you've described, you seem to prefer kinetic projectiles over "energy" type weapons. Why is that? |
| 03:21.38 | DrodoEmpire | Part of that is personal, emotional preference, as I find energy weapons to be-- and pardon my french-- a wee faggy :p |
| 03:21.55 | DrodoEmpire | But I'd argue there're practical things too |
| 03:22.45 | Methanogen | True, energy weapons tend to vary in...well everything depending on whIch fiction its from |
| 03:22.46 | DrodoEmpire | kinetic weapons are doubtless less expensive to build, and easier to make more powerful without endangering the user or making the thing prohibitively expensive |
| 03:22.50 | Methanogen | Cost would be one I'm imagining |
| 03:23.03 | Methanogen | True they are cheaper |
| 03:23.09 | Methanogen | And easier to make |
| 03:23.36 | DrodoEmpire | The Drodo solution was to make military grade firearms into coilguns, using a -really- powerful and energy-efficient chemical propellant, and using depleted uranium rounds |
| 03:23.45 | DrodoEmpire | Oh that's another thing |
| 03:23.49 | DrodoEmpire | More choice in ammunition |
| 03:23.50 | Methanogen | Ahh |
| 03:23.52 | Methanogen | Yes? |
| 03:23.53 | Methanogen | True |
| 03:24.14 | DrodoEmpire | Meanwhile... you might need a whole new energy weapon to significantly increase its power |
| 03:24.20 | Methanogen | Yorchi use a lot of heavy metals in ammunition since they aren't poisoned by it and there's a lot of them where they come from |
| 03:24.21 | DrodoEmpire | While taking up the same space |
| 03:24.24 | DrodoEmpire | Right, right |
| 03:24.26 | Methanogen | Good point |
| 03:24.39 | DrodoEmpire | Well, humans are poisoned by lead yet we use it in our ammo |
| 03:24.50 | Methanogen | Yeah we do |
| 03:25.03 | DrodoEmpire | So they could use lead, or depleted uranium |
| 03:25.17 | Methanogen | Both of those are viable options |
| 03:25.35 | DrodoEmpire | Either way, I use them for the above reasons and because I think they're a lot cooler |
| 03:25.36 | DrodoEmpire | :p |
| 03:25.40 | Methanogen | They have a lot of stuff like tungsten but I have no idea if that's any good for ammunition |
| 03:26.01 | DrodoEmpire | I've also based a lot of Drodo weapons (famed for their quality) off of real-world guns I sorta like lol |
| 03:26.20 | Methanogen | Fair enough |
| 03:26.39 | DrodoEmpire | Yeah might be good to go with lead or uranium, but I'd do some reading definitely |
| 03:27.17 | Methanogen | Yorchi tend to have problems with really malleable metals due to some of the less resistant ones melting in the atmosphere on their world, is that an issue for weapon production? |
| 03:27.33 | DrodoEmpire | Ooh very good question |
| 03:27.49 | Methanogen | Thanks |
| 03:27.51 | DrodoEmpire | It really could be an issue for ammunition production |
| 03:28.12 | DrodoEmpire | Aw, jeez, that could affect a -lot-... |
| 03:28.26 | Methanogen | Hence why I asked |
| 03:29.01 | DrodoEmpire | lead's good ammo partly because its common enough, its dense, and it'll deform, meaning it'll fit into the grooves of a rifle-barrel easily |
| 03:29.11 | DrodoEmpire | Through sheer force of impact from the bullet going off |
| 03:29.35 | Methanogen | Given their tech they could deliberately make use of cold rooms similar to how we melt metals except the opposite really for this, though it'd be expensive and useless if it just melts again as it comes out |
| 03:29.36 | DrodoEmpire | That's how the first battlefield-practical rifles worked |
| 03:29.45 | Methanogen | Hmmmm truuue |
| 03:30.06 | DrodoEmpire | And I cannot overstate how important those rifles were in the history of warfare and thus the world >.< |
| 03:30.15 | DrodoEmpire | The minie changed the game |
| 03:30.35 | Methanogen | I'm rather ignorant on the subject personally |
| 03:31.02 | Methanogen | Maybe a denser material could behave like lead in Yorchi conditions I'm not sure, but it seems important |
| 03:31.10 | Methanogen | That or we just use futuristic muskets |
| 03:31.12 | DrodoEmpire | You could get -really- detailed in this one subject, but I'd say the best thing to do is maybe look up a suitable-enough alternative if you're up to it and conclude that Yorchi gunsmithing suffers in quality as a reult? |
| 03:31.23 | DrodoEmpire | Well that's sorta what I was thinking |
| 03:31.40 | DrodoEmpire | Maybe due to issues with rifling, Yorchi firearms tend to be really inaccurate |
| 03:32.09 | DrodoEmpire | Which might mean they use a lot of shotguns, submachineguns which emphasize rate of fire over accuracy, and melee weapons? |
| 03:32.15 | Methanogen | Maybe they view smaller firearms as inherently inaccurate and rely on idk artillery for long range |
| 03:32.23 | Methanogen | I was thinking they'd have a lot of shotguns |
| 03:32.30 | DrodoEmpire | Artillery's always been used for long range so yeah |
| 03:32.42 | DrodoEmpire | They might also invest a lot in armour that stops small-calibre bullets -really- well |
| 03:32.47 | Methanogen | Multiple impacts like that is the best way to crack through Yorchi's natural defences as well, if that matters at all |
| 03:32.52 | DrodoEmpire | Ahh |
| 03:33.34 | DrodoEmpire | So yeah, Yorchi warfare would probably strongly emphasise really close-range firefights and brawls with pistols and swords and knives and the like |
| 03:33.42 | Methanogen | Bluntish attacks in multiple areas shatters their shells and exoskeletons whereas singular sharpened ones are resisted |
| 03:33.46 | Methanogen | Yes most likely |
| 03:34.04 | DrodoEmpire | Alright cool |
| 03:34.25 | DrodoEmpire | Arty and tanks and the sort would also suffer just so you know |
| 03:34.28 | Methanogen | It's interesting to me seeing how all this stuff affects the history of their warfare |
| 03:34.32 | Methanogen | They would yeah |
| 03:34.34 | DrodoEmpire | Cannon would be less accurate for example |
| 03:34.45 | Methanogen | But they can afford to be expensive and large |
| 03:34.59 | DrodoEmpire | Meaning battles in general would be on smaller battlefields, closer to premodern sizes and premodern timeframes |
| 03:35.06 | DrodoEmpire | Yeah it all factors in |
| 03:35.09 | Methanogen | Would explosive weapons like missiles suffer a lot as well! |
| 03:35.13 | Methanogen | *? |
| 03:35.21 | DrodoEmpire | Missiles might be okay |
| 03:35.31 | DrodoEmpire | Which would make them the rare, valuable precision weapon |
| 03:35.35 | DrodoEmpire | Well |
| 03:35.37 | Methanogen | Yes true |
| 03:35.52 | DrodoEmpire | Missiles are actually -really- inaccurate, depending on the type |
| 03:36.01 | Methanogen | I'd imagine Yorchi would have very expensive but powerful and accurate missiles to make the most of them |
| 03:36.10 | DrodoEmpire | Makes sense |
| 03:36.25 | DrodoEmpire | Instead of like in WWI on where battles could last weeks or months and frontlines would span many dozens or hundreds of kilometres |
| 03:37.01 | Methanogen | Their battles would be quick although still very brutal |
| 03:37.03 | DrodoEmpire | Yorchi warfare might remain premodern-style, in that battlefields are a few square km with a huge number of troops in that space, and the battles would be over in an afternoon, or a few days |
| 03:37.11 | DrodoEmpire | Probably more brutal |
| 03:37.38 | Methanogen | So many warriors clustered together would be an excellent target for bombs and chemical weapons and such wouldn't it? |
| 03:37.43 | DrodoEmpire | We're talking firearms with an effective range of a musket, but a rate of fire of UZIs >.< |
| 03:37.46 | DrodoEmpire | Yes |
| 03:38.13 | Methanogen | Yes essentially, rather unusual firearms by our standards |
| 03:38.30 | DrodoEmpire | Which might be all the more reason for the lot of them to be equipped in NBC gear of some sort, and likely also heavy armour to help deflect small arms |
| 03:38.31 | Methanogen | I wonder if flamethrower would be very effective in Yorchi warfare |
| 03:38.37 | DrodoEmpire | Oh yeah for sure |
| 03:38.59 | Methanogen | So they'd actually be seen quite a bit instead of rarely |
| 03:39.10 | DrodoEmpire | Unless somebody really goes all out with their armour and makes it flame retardant, but I'm beginning to think these heavily-armoured folks would be a rare sight |
| 03:39.18 | DrodoEmpire | Yeah for sure |
| 03:39.45 | Methanogen | Yeah they'd be heavily armoured and armed and expensive |
| 03:40.26 | Methanogen | Actually, if their weapons are really inaccurate, would they even bother with scopes and such? |
| 03:40.52 | DrodoEmpire | ironsights and maybe red-dots at most |
| 03:41.05 | DrodoEmpire | Accuracy wouldn't be a priority you're right |
| 03:41.16 | Methanogen | Yes, they only need short range aiming aids |
| 03:41.26 | DrodoEmpire | I can see a lot of these guns being things like SMGs, or machine pistols, or shotguns |
| 03:41.40 | DrodoEmpire | Rifles would be bulky and the extra length not very usefu; |
| 03:41.43 | Methanogen | They'd want guns with lots of ammunition to clear out the waves coming at them, and stuff like shotguns and the like I'd imagine |
| 03:41.47 | Methanogen | Yes agreed |
| 03:41.47 | DrodoEmpire | ^ |
| 03:42.16 | DrodoEmpire | Their biggest issue would be how to fit as many rounds into a mag at once and how quickly you can get it downrange |
| 03:42.22 | Methanogen | I now have an image of a battlefield so covered in corpses that it's conventional to use fallen soldiers as cover |
| 03:42.25 | Methanogen | Yes exactly |
| 03:42.28 | DrodoEmpire | Possibly |
| 03:42.41 | DrodoEmpire | I can see cover and situational awareness being -crucial- though |
| 03:42.53 | Methanogen | Yes they would be |
| 03:42.56 | DrodoEmpire | Much like today's urban combat |
| 03:42.56 | Methanogen | One mistake and you're dead |
| 03:43.14 | Methanogen | It'd be a very intense kind of warfare |
| 03:43.18 | DrodoEmpire | ^ |
| 03:43.51 | Methanogen | And extremely brutal |
| 03:44.38 | DrodoEmpire | Yeah |
| 03:44.46 | DrodoEmpire | Though, keep in mind the inaccuracy of these things |
| 03:44.57 | Methanogen | Yes true |
| 03:45.13 | Methanogen | Weapons wouldn't be that reliable as a result |
| 03:45.15 | DrodoEmpire | You'd need to be real close to hit anything even if you unload the entire mag in that direction |
| 03:45.17 | DrodoEmpire | Well |
| 03:45.31 | DrodoEmpire | You could still make them reliable, -especially- if you don't have accuracy as a concern |
| 03:45.45 | DrodoEmpire | Its part of why the AK-47 is unbreakable |
| 03:45.52 | Methanogen | Just not at hitting things and long range |
| 03:45.55 | Methanogen | It is? |
| 03:46.22 | Methanogen | I guess if they aren't really bulky they could be more compact and ergonomic and have less areas for issues to happen |
| 03:46.33 | DrodoEmpire | It isn't very accurate, and that's because its made of about... two parts, and its ejection port and chamber and everything are huge |
| 03:46.37 | DrodoEmpire | Hard to gum it up |
| 03:46.42 | DrodoEmpire | But it means it lacks precision |
| 03:46.59 | DrodoEmpire | So these guns might be impeccably-reliable by simple accident xD |
| 03:46.59 | Methanogen | Hmmm...with such large rates of fire and ammo counts wouldn't cooling become a problem? |
| 03:47.02 | Methanogen | Ahhhh |
| 03:47.07 | DrodoEmpire | Yep, definitely |
| 03:47.16 | DrodoEmpire | These fuckers would overheat like its no one's business |
| 03:47.36 | DrodoEmpire | Might need some investment in materials science to figure that out? |
| 03:47.39 | Methanogen | And sulfuric acid isn't the best coolant for metal is it |
| 03:47.46 | DrodoEmpire | I don't think so hur |
| 03:48.12 | Methanogen | The exterior would be designed to handle it but probbably not the inside |
| 03:48.25 | Methanogen | Maybe overheating is seen as inevitable with a lot of small arms to them |
| 03:48.27 | DrodoEmpire | Seems a bit backward from and engineering standpoint |
| 03:48.47 | DrodoEmpire | One thing you -could- do is make the barrels and the bolt and everything else as easy to replace as the magazine |
| 03:48.54 | DrodoEmpire | Fire off a mag? reload. |
| 03:49.07 | Methanogen | Hmmmm good point |
| 03:49.11 | DrodoEmpire | Fire off another and the barrel's piping-hot? twist it out, spin in a new one, you're good to go |
| 03:49.25 | DrodoEmpire | Its what the Germans did with the Spandau (their machine gun) |
| 03:49.33 | DrodoEmpire | *in WWII |
| 03:49.45 | DrodoEmpire | They made the barrel so you could just twist it off and put in a new one |
| 03:49.47 | Methanogen | So they'd have a lot of spare weapon parts and just replace the overheated ones with those |
| 03:49.50 | Methanogen | I like that idea |
| 03:49.58 | DrodoEmpire | Yeah, and make it as easy and modular as reloading |
| 03:50.13 | DrodoEmpire | I can see guns being really cheaply made for the most part as a result |
| 03:50.16 | DrodoEmpire | Like Stens almostg |
| 03:50.24 | Methanogen | Yes |
| 03:50.30 | Methanogen | Cheap, replaceable, expendable |
| 03:50.53 | DrodoEmpire | ...You know |
| 03:51.01 | DrodoEmpire | These sorts of guns -could- see some use abroad |
| 03:51.33 | DrodoEmpire | I can see gangsters and the sort eager to get their hands on a cheap-as-dirt SMG that can spray bullets down a city block like its nothing |
| 03:51.52 | Methanogen | True, they would actually |
| 03:52.21 | DrodoEmpire | Depends on the Yorchi's enthusiasm about letting their gun companies trade abroad, of course, but its possible that they fill a niche role and fill it really well |
| 03:52.31 | Methanogen | And can be easily replaced if mysteriously lost or broken |
| 03:52.44 | DrodoEmpire | ^ |
| 03:52.48 | Methanogen | I'll have to consider that |
| 03:54.48 | Methanogen | These weapons have some rather unique properties that could certainly fill a particular niche |
| 03:55.10 | DrodoEmpire | Absolutely |
| 03:55.40 | Methanogen | Of course they're useless at anything beyond close range, but to some people that doesn't really matter much |
| 03:56.19 | DrodoEmpire | ^ |
| 03:56.40 | Methanogen | Actually, I just realised, how useful would grenades be in this kind of warfare we've discussed? |
| 03:57.12 | DrodoEmpire | Quite useful |
| 03:57.21 | DrodoEmpire | Espeically if the battle shifted to an urban setting |
| 03:57.32 | Methanogen | Yes true |
| 03:58.03 | Methanogen | This kind of war could devastate a city given the inaccuracy and the focus on killing clusters of enemies |
| 03:59.13 | DrodoEmpire | Could, could |
| 03:59.16 | DrodoEmpire | As would any battle |
| 03:59.30 | Methanogen | Of course, cities have plenty of useful cover for soldiers compared to say a forest or open ground |
| 03:59.35 | Methanogen | True any battle can |
| 04:00.06 | DrodoEmpire | Eh, yeah, depends |
| 04:00.21 | DrodoEmpire | Cities are also probably the most treacherous places to fight in, too |
| 04:00.27 | Methanogen | This sort of thing is rather situational |
| 04:01.04 | DrodoEmpire | ^ |
| 04:01.18 | Methanogen | True, ambushes come from everywhere, verticality becomes a major issue, can be hard to escape from powerful explosives and such and can be difficult to fit certain vehicles in well |
| 04:01.38 | DrodoEmpire | Yep |
| 04:01.39 | Methanogen | But really this is situation specific |
| 04:01.48 | DrodoEmpire | Eh, to an extent |
| 04:01.52 | DrodoEmpire | Anyway |
| 04:01.55 | DrodoEmpire | I need to go as its late |
| 04:01.59 | Methanogen | Yes? |
| 04:02.03 | Methanogen | Fair enough, nice talking |
| 04:02.09 | Methanogen | I should go as well really |
| 04:02.14 | DrodoAway | Beep me if you have any questions, I can try to answer them by morning |
| 04:02.16 | DrodoAway | Ahh, kk |
| 04:02.30 | Methanogen | Thanks for helping me get the basis down for modern Yorchi warfare |
| 05:57.05 | *** join/#sporewiki Liquid_Ink (79d0cd9d@gateway/web/freenode/ip.121.208.205.157) |
| 07:45.51 | *** join/#sporewiki Methanogen (79dacdc7@gateway/web/freenode/ip.121.218.205.199) |
| 07:45.56 | Methanogen | Hello |
| 09:35.27 | *** join/#sporewiki Ghelae (569581f8@gateway/web/freenode/ip.86.149.129.248) |
| 09:35.27 | *** mode/#sporewiki [+o Ghelae] by ChanServ |
| 09:48.17 | *** join/#sporewiki Imperios (~Imperios@91.108.29.140) |
| 10:20.26 | *** join/#sporewiki Methanogen (79dacdc7@gateway/web/freenode/ip.121.218.205.199) |
| 10:20.31 | Methanogen | Hello |
| 10:20.39 | Ghelae | Hello. |
| 10:20.58 | Methanogen | Ah hi Ghelae, how are you? |
| 10:21.22 | Ghelae | I'm okay; how about you? |
| 10:21.35 | Methanogen | I'm good |
| 10:21.45 | Methanogen | Getting progress done on my empires and such |
| 10:26.54 | Methanogen | Slow progress, but progress nonetheless |
| 10:40.01 | *** join/#sporewiki ImpyDroid (~yaaic@host-216-157-66-217.spbmts.ru) |
| 10:42.06 | Methanogen | Hi |
| 10:44.44 | *** join/#sporewiki Jepardi (587181ae@gateway/web/freenode/ip.88.113.129.174) |
| 10:44.46 | Jepardi | Hi |
| 10:45.01 | Methanogen | Hi |
| 10:45.49 | Methanogen | How are you? |
| 10:51.02 | Methanogen | Gtg |
| 11:13.14 | ImpyDroid | Hi |
| 11:16.41 | ImpyDroid | Liquid_Ink: https://youtu.be/chheYBWbjdk |
| 11:17.53 | Liquid_Ink | Off to conquer India, presumably. |
| 11:22.16 | *** join/#sporewiki Methanogen (79dacdc7@gateway/web/freenode/ip.121.218.205.199) |
| 11:22.24 | Methanogen | Hello everyone |
| 11:23.42 | Ghelae | Hello. |
| 11:25.08 | Methanogen | I've noticed that restructuring of taxonomy with Invertebrata and such has been completed |
| 11:26.12 | *** join/#sporewiki dino82 (52b0d621@gateway/web/freenode/ip.82.176.214.33) |
| 11:26.22 | dino82 | hi |
| 11:26.25 | Liquid_Ink | Hey Dino! |
| 11:26.26 | Methanogen | Hi there |
| 11:26.53 | dino82 | :d |
| 11:27.31 | Liquid_Ink | How are you? |
| 11:28.13 | Ghelae | Hello. |
| 11:28.50 | Ghelae | Methanogen: Yes; I've noticed you put the Eriaroon in Teuthidae, which I would have suggested to be the appropriate family in the new scheme. |
| 11:29.45 | Methanogen | I tried to look through it to see what would be best and thought I might as well try put it in the right one- it'd be easy to fix up anyway |
| 11:30.37 | *** join/#sporewiki OluapPlayer (b3dc2a60@gateway/web/freenode/ip.179.220.42.96) |
| 11:30.38 | *** mode/#sporewiki [+o OluapPlayer] by ChanServ |
| 11:31.12 | Methanogen | Hello |
| 11:31.26 | Ghelae | Hello. |
| 11:33.19 | Methanogen | Hopefully the new system will reduce unnecessary taxons |
| 11:34.05 | OluapPlayer | hi |
| 11:34.27 | Ghelae | One issue that occasionally arose was that people would complain about how the taxonomy didn't match real-world classification. Now it should be more obvious that it isn't supposed to. |
| 11:34.35 | Methanogen | True |
| 11:34.53 | Methanogen | Real world classification isn't very efficient to apply in this situation |
| 11:35.47 | Methanogen | Actually, what was the original purpose of creating a SporeWiki taxonomy system? |
| 11:35.56 | Methanogen | Was it j |
| 11:36.22 | Methanogen | *was it just intended to classify creatures or was it intended to make things more organised or something |
| 11:36.47 | Ghelae | I don't actually know. |
| 11:36.53 | Ghelae | checks the taxonomy page and its history for clues |
| 11:39.00 | dino82 | @liquid: I am great thanks! Finally some free time and you? |
| 11:39.04 | Ghelae | It's never said anything more than in the current intro, "The project's mission is to scientifically catalogue as many user-made Sporian life forms as possible, including creature, cell and plant specimens." |
| 11:39.23 | Ghelae | So I guess somebody just thought it would be an interesting thing to do. |
| 11:39.32 | Methanogen | So I guess it was just a project to do to classify stuff |
| 11:39.35 | Methanogen | Yes |
| 11:40.40 | Methanogen | Well it is interesting to me at least to see how everything is classified |
| 11:42.18 | Methanogen | It's probably random, but I've noticed that the Yorchi provides the image thing for Telumcorpus now, which makes me feel like I've accomplished something for some reason |
| 11:45.10 | Ghelae | Then I shouldn't tell you that it is random and can be changed by editing the page or adding ?action=purge to the end of the web address to refresh it. :P |
| 11:45.50 | Methanogen | Ah I thought it was random |
| 11:46.59 | Methanogen | Kind of random question, but in terms of ridiculousness of divergence point, what's the worst taxon you've seen before? |
| 11:48.08 | Ghelae | I don't remember. It might still be around, buried somewhere in the depths of Reptilia. |
| 11:48.38 | Methanogen | Now I've got to look to see what's in Reptilia |
| 11:49.44 | Methanogen | Found a tax on with no species in it |
| 11:50.52 | Methanogen | "Experimentaphade" in Reptilia, the point of divergence appears to be "a reptile made from DNA strands from multiple creatures", seems rather monospecific to me |
| 11:51.42 | Ghelae | Thanks. |
| 11:51.46 | Ghelae | deletes it |
| 11:53.13 | Methanogen | Another monospecific taxon in there is Chamaeleonidae, which seems to refer to chameleon-like creatures and has exactly one species in it |
| 11:54.57 | Methanogen | Similar is Venopodidae with refers very specifically to "lizards with venom sacs where their front legs should be" which also has exactly one species within it |
| 11:55.45 | Methanogen | Also, Moisonidae has no species in it at all |
| 11:59.22 | *** join/#sporewiki Monet (~Monet47@cpc90522-gill20-2-0-cust960.20-1.cable.virginm.net) |
| 11:59.39 | Methanogen | Hi |
| 12:00.21 | Ghelae | Hello. |
| 12:00.50 | Ghelae | I'll delete unused taxa, but getting rid of monospecific ones requires looking around to find a better family to put their creatures in. |
| 12:01.03 | Methanogen | True fair point |
| 12:01.10 | Methanogen | I'll just look around for empty ones |
| 12:06.24 | *** join/#sporewiki AndroImp (~yaaic@109.167.246.67) |
| 12:06.36 | Methanogen | Hello |
| 12:06.38 | dino82 | new chapter: http://spore.wikia.com/wiki/Fiction:Tertius_Bellum/Struggle_of_being_a_Half-Elf#Chapter_05 |
| 12:06.45 | dino82 | Yvenne has drawn the attention of the Legatus |
| 12:06.48 | dino82 | hi |
| 12:11.32 | Methanogen | I have to go |
| 12:15.28 | dino82 | bye |
| 12:24.01 | *** join/#sporewiki Hachiman (4eca2a12@gateway/web/freenode/ip.78.202.42.18) |
| 12:24.17 | Hachiman | Hi |
| 12:25.43 | *** join/#sporewiki ImpyDroid (~yaaic@217.66.157.152) |
| 12:26.35 | Hachiman | Went to visit a Medieval castle and village today in some southern French highlands |
| 12:26.38 | dino82 | hi |
| 12:33.37 | *** join/#sporewiki Hachiman (4eca2a12@gateway/web/freenode/ip.78.202.42.18) |
| 12:33.40 | Hachiman | Hi |
| 12:34.12 | dino82 | hi |
| 12:39.55 | Hachiman | Shame Wormy isn't here |
| 12:40.08 | Hachiman | Made more progress on Proxima recently and wanted to tell him about recent events |
| 12:45.33 | ImpyDroid | OluapPlayer: https://youtu.be/iZAJdItOLIU >surgiu Vargash |
| 12:45.56 | ImpyDroid | Wow wow so that Brazilian fascist guy's surname is actually pronounced "Vargash"? |
| 12:47.54 | OluapPlayer | Vargas, not Vargash |
| 12:49.14 | ImpyDroid | Yeah but in this song it is pronounced "Vargash" |
| 12:50.16 | Monet | Could it be the audio quality? |
| 12:50.26 | ImpyDroid | I think it is just Portuguese |
| 12:51.01 | ImpyDroid | From what I remember with my conversations with Irsk it has a lot of sh sounds |
| 12:53.52 | Monet | Could that be a difference between European and Brazillian Portuguese? |
| 12:54.42 | ImpyDroid | Well so would Vargas be pronounced "Vargash" in Portuguese, |
| 12:54.44 | ImpyDroid | * |
| 12:54.46 | ImpyDroid | ? |
| 13:03.08 | Monet | Hachiman: Sounds beautiful. |
| 13:07.24 | Monet | I think it's the local materials but Southern European architecture is beautiful. Chateaus can be pretty grand too. |
| 13:07.33 | Hachiman | Aye |
| 13:07.47 | Hachiman | Visited a church, that was quite serene |
| 13:08.06 | Hachiman | I find it curious how villages are arranged around castles |
| 13:08.40 | Monet | How so? |
| 13:08.46 | Hachiman | As in, the actual layout |
| 13:11.19 | Monet | Okay. |
| 13:12.37 | Monet | Not sure how it's done in Europe besides examples like Carcassonne and Mont St. Michelle. From what I gather a lot of highlands towns are laid out to take advantage of the hills and cliffs. |
| 13:13.12 | Hachiman | Yeah |
| 13:13.23 | Hachiman | I just find that kind of astounding how they achieved that |
| 13:13.34 | Hachiman | They're not flat at all; they're very elevated |
| 13:13.45 | Monet | Like this? https://s-media-cache-ak0.pinimg.com/736x/14/69/17/14691736edc38072cbd1b9bd68eaff3f.jpg |
| 13:14.54 | Monet | It's quite remarkable what can be built with the right approach.. |
| 13:15.16 | Hachiman | Yeah, like those buildings actually built into the side of the hill / cliff |
| 13:15.38 | Monet | Oh now those are impressive. |
| 13:16.19 | dino82 | looks like a rambo castle :D |
| 13:16.47 | Hachiman | Like, I was walking around and saw houses and gites elevated upwards and downwards into the side of the hill |
| 13:17.14 | Monet | It might be the rock - when I was in Rome I visited one of its several catacombs, the tour guide talked about how the igneous rock was quite easy to cut into and after some time exposed to air it hardened. |
| 13:20.21 | Monet | dino82: A castle on a platform or hil was highly desirable as it made the place much more difficult to assault. |
| 13:20.35 | dino82 | yeah I know! Europe has lots of castles |
| 13:20.38 | dino82 | germany as well |
| 13:20.43 | dino82 | though France has beuatiful ones |
| 13:22.33 | Monet | For its divided history and its history of revolution and unrest, I'm surprised how widespread the palace-like chateaus were. |
| 13:23.08 | dino82 | yeah and well made and sturdy to witstand the teeths of time |
| 13:23.47 | dino82 | castle in the neterhaldns were often smaller but often made use of water around it |
| 13:24.10 | *** join/#sporewiki NeonPanda (3ce6aeb1@gateway/web/freenode/ip.60.230.174.177) |
| 13:24.14 | dino82 | German castles: https://en.wikipedia.org/wiki/List_of_castles_in_Germany |
| 13:24.17 | NeonPanda | holy SHIT rimworld got intense just then |
| 13:24.19 | dino82 | very nice ones as well |
| 13:24.30 | Monet | A lot of French castles were I think converted into manors or palaces while al to of English castles were simply abandoned |
| 13:25.28 | Hachiman | NeonPanda: What happened? |
| 13:25.59 | NeonPanda | step 1: blight wipes out most of my crops |
| 13:26.08 | NeonPanda | step 2: toxic fallout makes it hazardous to venture outside |
| 13:26.24 | Hachiman | fug |
| 13:26.38 | NeonPanda | step 3: volcanic ash cloud reduces power generation from solar panels and drops temperature and light levels, making it harder to grow crops |
| 13:27.05 | NeonPanda | oh and did I mention the toxic fallout also killed EVERYTHING on the map making hunting and foraging impossible |
| 13:27.18 | OluapPlayer | throw hachi into the volcano as a human sacrifice |
| 13:27.21 | OluapPlayer | appease the gods of the magma |
| 13:27.21 | dino82 | have to go |
| 13:27.22 | dino82 | bye bye |
| 13:27.23 | Hachiman | So, how did you overcome it |
| 13:27.25 | NeonPanda | I was somewhat tempted |
| 13:27.47 | NeonPanda | I built a gigantic undermountain hydroponics facility |
| 13:28.43 | NeonPanda | in order to sustain it I had to build an additional geothermal generator and five wind turbines, meaning I had to be constantly producing more machine components, which are themselves expensive and slow to get |
| 13:29.19 | Hachiman | Jesus |
| 13:29.47 | NeonPanda | had to butcher my buffalos too ;-; |
| 13:30.00 | OluapPlayer | rip moo |
| 13:30.26 | Hachiman | So, with your hydroponics facility built, what's next? |
| 13:31.16 | NeonPanda | well, I managed to keep above water so to speak by trading for food, then after a while the toxic fallout stopped |
| 13:31.27 | NeonPanda | still had the ash to deal with, but at least animals started reappearing |
| 13:32.03 | Hachiman | Ah, so they do return |
| 13:32.14 | Monet | To pass the time your colonists could be lsitening to old 1950s tunes. |
| 13:32.16 | NeonPanda | so I kitted out my sniper team and essentially just ordered them to shoot every living thing that doesn't explode on death, and for a while they were the sole supply of food in the camp |
| 13:32.51 | Hachiman | I imagine Rimworld probably makes for a great source of sci-fi survival stories |
| 13:32.52 | OluapPlayer | >explode on death |
| 13:32.53 | NeonPanda | the ash finally settled, and I was just like "fuck it, I need a break" |
| 13:32.59 | OluapPlayer | elaborate pls |
| 13:33.04 | Hachiman | Just as Dorf Fort probably makes for a good source of fantasy survival stories hur |
| 13:33.18 | NeonPanda | OluapPlayer: Boomalope. |
| 13:34.07 | NeonPanda | literally exploding antelope |
| 13:34.30 | OluapPlayer | I've actually looked for means to make creatures explode on death in DF, but there isn't any |
| 13:34.32 | OluapPlayer | would be fun |
| 13:35.31 | NeonPanda | every so often you get a maddened herd of boomalope that try to kill your colonists by the most direct means necessary, including kamikaze-ing your walls |
| 13:35.45 | Hachiman | Mootherfuckers |
| 13:35.47 | OluapPlayer | And seems Rimworld has actually funtional volcanoes, which's cool |
| 13:36.01 | OluapPlayer | DF's volcanoes atm are just holes on the surface with magma in them |
| 13:37.29 | NeonPanda | so far the only thing that hasn't gone fucky for me is an insect infestation |
| 13:37.39 | NeonPanda | I've had basically every other kind of disaster that exists |
| 13:37.45 | OluapPlayer | What's this toxic fallout do? Does it just kill people? |
| 13:38.45 | NeonPanda | living things not under a roof get buildup of Toxic Fallout, which progressively debuffs them until they literally just fall over and start dying |
| 13:38.58 | NeonPanda | it goes down over time, but it's a long time |
| 13:39.02 | OluapPlayer | Right, not the mutating kind of fallout then |
| 13:39.09 | NeonPanda | I wish |
| 13:39.35 | NeonPanda | would be interesting to see what the retard who works my farm turns into :P (and I'm not even being offensive, he's literally mentally retarded) |
| 13:40.19 | OluapPlayer | DF has evil weather. Parts of the world are "evil" and have strange weather, like rain of toxic sludge, slime or dwarf/elf/human/goblin blood |
| 13:40.22 | NeonPanda | basically the only things he can do are grow and cut plants, and move things from one plae to another |
| 13:40.35 | NeonPanda | he does those things very well though, and I love him for it |
| 13:41.08 | OluapPlayer | settling in an area where it rains elf blood would be metal as fuck though I've never had the luck to find one such place |
| 13:41.20 | NeonPanda | that would be pretty metal |
| 13:41.22 | NeonPanda | *takes notes* |
| 13:41.36 | OluapPlayer | About half of the evil regions are also infested with undead |
| 13:42.09 | OluapPlayer | Any corpse dies in the area and isn't completely mutilated has a chance of rising up again |
| 13:42.14 | OluapPlayer | that dies* |
| 13:42.14 | NeonPanda | oh also, minor note but still neat, my colony has now outgrown the original extent of the mountain it built into, so if you were to look at it in side view you'd basically see a granite box with a mountain sticking out the top |
| 13:42.32 | NeonPanda | literally any fantasy character I've played: HOLIDAY *grabs mace* |
| 13:42.34 | OluapPlayer | Including things like hair, skin, reptile scales |
| 13:43.42 | NeonPanda | I did however have a very successful raid defence tonight; got attacked by at least 12-14 people, managed to break them with only one person going down |
| 13:43.52 | OluapPlayer | They're actually bugged because you're unable to damage these undead tissues and they're too small to damage dwarves. So when they fight, the dwarves keep fighting until they inevitably die of dehydration |
| 13:44.13 | NeonPanda | bloody greatbows are annoying as hell |
| 13:44.31 | NeonPanda | comparable range to sniper rifles and still capable of dealing significant damage |
| 13:45.38 | NeonPanda | bunch of tribespeople attacked, a few with greatbows, some with throwing spears and the rest with melee weapons, became a balancing act of trying to snipe off the bow users while tying up their melee guys with mine |
| 13:45.53 | OluapPlayer | The most evil regions have "evil clouds" which lurk around the surface. Contact with them transforms the victim into a super undead murderfucker with super fighting skills |
| 13:45.53 | OluapPlayer | surface = bad |
| 13:46.06 | NeonPanda | heh |
| 13:54.48 | NeonPanda | and now I pass out |
| 14:33.23 | *** join/#sporewiki Wormy_ (02184624@gateway/web/freenode/ip.2.24.70.36) |
| 14:34.06 | Wormy_ | Looking for Mothers day events tomorrow, everything in the Midlands seems to about "afternoon tea at x", "afternoon tea at x", "afternoon tea at x" blah blah blah |
| 14:34.38 | Wormy_ | Nothing actually interesting, instead overly priced tea and cake that willprobably turn out dry |
| 14:34.50 | Wormy_ | and crammed |
| 14:35.22 | Wormy_ | Its like the Midlands tourist associations got together with a bloody afternoon tea idea this yar |
| 14:36.12 | *** join/#sporewiki Tek0516 (uid149600@gateway/web/irccloud.com/x-btmozxuarojajbvn) |
| 14:36.15 | Wormy_ | I chanced upon A 2013 timetable by accident and there were far more interesting things, like steam train rallies and photographic collage making etc. |
| 14:37.44 | Wormy_ | And in my town "Take your mother to the farmers market this Sunday" |
| 14:39.43 | Wormy_ | And mothers day cards suck sweaty arse |
| 15:25.03 | Monet | Hachiman: SO I just had a thought while reading random stuff. |
| 15:25.14 | Hachiman | Oh? |
| 15:25.18 | Monet | If the Warp exists, does that mean Kanye West's divinity is real? |
| 15:25.29 | Hachiman | Hm |
| 15:25.46 | Hachiman | Does that mean Kanye West is a Warp-sensitive? |
| 15:26.57 | Monet | Or maybe he is partially divine because he's convinced a few million peopel that he is, but doesn't have any direct power. |
| 15:27.34 | Monet | Or Kanye West is actually a daemon that has taken the form of a supremely arrogant and egotistical black man. |
| 15:28.43 | Hachiman | I mean |
| 15:28.52 | Hachiman | That's not entirely out of the question |
| 15:33.39 | Monet | This is what I find enjoyable about the Warp |
| 15:34.20 | Monet | Though the power of collective belief, anything from a six-titted succubus to the Candyman could manifest there. |
| 15:45.07 | *** join/#sporewiki Imperios (~Imperios@91.108.29.167) |
| 15:45.23 | Hachiman | Hi |
| 15:45.38 | Imperios | Hey |
| 15:49.00 | Imperios | OluapPlayer: https://cs541601.userapi.com/c836121/v836121441/2d29e/orxxB3DjBYI.jpg Russian Dalaran |
| 15:49.26 | OluapPlayer | hur |
| 17:31.18 | *** join/#sporewiki AtsyBoi (415d905e@gateway/web/freenode/ip.65.93.144.94) |
| 17:31.27 | AtsyBoi | A |
| 17:33.15 | Monet | hi |
| 17:54.09 | AtsyBoi | Can I have a map of the Milky Way? |
| 17:55.12 | Ghelaway | AtsyBoi: http://spore.wikia.com/wiki/File:Milky_Way_map_5.png |
| 18:02.25 | AtsyBoi | Ghelaway: Can I add an empire? |
| 18:05.19 | AtsyBoi | Also, which side points to the magellanic clouds? |
| 18:07.05 | *** join/#sporewiki drom (~drom@unaffiliated/drom) |
| 18:07.18 | drom | Hello |
| 18:07.28 | AtsyBoi | Hey Drom |
| 18:08.13 | AtsyBoi | Need some help with a map, which side is Magellanic Cloudwards and can I add an empire? http://spore.wikia.com/wiki/File:Milky_Way_map_5.png |
| 18:09.25 | Ghelaway | I guess you can add an empire; the Milky Way is an open galaxy. |
| 18:09.42 | Ghelaway | As for the Clouds... |
| 18:13.30 | AtsyBoi | wait what are the unlabeled ones? |
| 18:15.06 | Ghelaway | The LMC has a right ascension of ~5h 23m, and the SMC has a RA of ~0h 52m. There are 24 hours in a full circle and the galactic centre is at ~17h 45m, so the Clouds are between 7/24 and 12/24 of a circle away from the centre, as viewed from Sol. |
| 18:15.25 | AtsyBoi | so bottom right? |
| 18:15.36 | Ghelaway | I'm not certain whether that's clockwise or anticlockwise, but for the LHC it doesn't matter: it's on the opposite side of Sol to the galactic centre. |
| 18:15.46 | Ghelaway | Bottom right, yes. |
| 18:15.47 | AtsyBoi | Ok |
| 18:15.55 | AtsyBoi | Thanks |
| 18:16.52 | Ghelaway | I think the hours increase anticlockwise on that map, so the SMC is pretty much beyond the bottom-right corner while the LMC is closer to rightwards. |
| 18:17.10 | AtsyBoi | Even better to know |
| 18:17.16 | AtsyBoi | ~highfive Ghelaway |
| 18:17.59 | Ghelaway | Ah, no. I now think it's the other way around, so the SMC is more directly rightwards. |
| 18:18.04 | Ghelaway | Not that it makes much difference. |
| 18:18.31 | AtsyBoi | eh |
| 18:18.40 | AtsyBoi | Still good to know |
| 18:28.15 | *** join/#sporewiki Luxor (5efea42c@gateway/web/freenode/ip.94.254.164.44) |
| 18:28.31 | Luxor | evening |
| 18:29.08 | drom | Hello |
| 18:32.45 | Monet | http://spore.wikia.com/wiki/Fiction:Third_House_War#Operation_Guillotine did a thing |
| 18:34.25 | Luxor | Nex generations which will come across our small realm hidden in vast ocean of internet full of cats and memes will see these walls of text we've once written. |
| 18:34.35 | Luxor | And they'll be shocked that someone had enough will to do that |
| 18:34.43 | Luxor | uh, next* |
| 18:35.26 | Luxor | Nonethless that's really well made |
| 18:36.23 | Luxor | Also: trying to figure out if a compound linked below could exist (and be stable): |
| 18:36.26 | Luxor | http://molview.org/?smiles=C([H])([H])([H])C([H])(C([H])([Si](O[H])=O)C(=O)O[H])O[H] |
| 18:36.30 | Luxor | Praise SMILES |
| 18:40.24 | drom | I see nothing but a string of chemical elements |
| 18:41.54 | Ghelaway | Luxor: I clicked the link and got "Failed to load structure from its database". |
| 18:47.39 | Luxor | uh. |
| 18:48.03 | Luxor | ...yeah, same to me. |
| 18:48.48 | Luxor | So, maybe, in another way: SiOOH, with same structure as COOH. |
| 18:49.04 | Luxor | As for bond strengths, it seems that such structure should be stable. |
| 18:52.40 | Luxor | The compound itself is: CH3-CH(OH)-CH(COOH)-SiOOH |
| 18:53.00 | Luxor | with data in brackets stand for branches of the compound |
| 18:53.57 | drom | Monet: I had been thinking a bit on the idea. I am feeling an urge to throw in more aberrations and other creatures like vampires, while werewolves and undead stand out as dominant forces. The werewolves being, well, the benevolent force. |
| 19:15.38 | *** join/#sporewiki dino82 (52b0d621@gateway/web/freenode/ip.82.176.214.33) |
| 19:25.37 | AtsyBoi | Dude, you KNOW that program!? |
| 19:25.40 | AtsyBoi | Awesome! |
| 19:27.04 | drom | Who talking to who? |
| 19:27.23 | AtsyBoi | Luxor |
| 19:35.01 | *** join/#sporewiki Imperios (~Imperios@91.108.29.167) |
| 19:35.04 | drom | Unfortunately, your message was about 12 mins off Luxor's departure |
| 19:39.04 | drom | suka blyad |
| 19:43.30 | dino82 | HI |
| 19:57.29 | drom | ÐмпеÑиоÑ, еÑо дÑом. |
| 20:01.05 | AtsyBoi | nyet |
| 20:04.19 | AtsyBoi | so |
| 20:05.28 | AtsyBoi | i need help starting up an empire |
| 20:08.24 | AtsyBoi | drom: can i get some help w/ an empire? |
| 20:08.43 | drom | Хмм? |
| 20:10.30 | AtsyBoi | i want to start one up |
| 20:10.47 | drom | Time for a pop quiz |
| 20:10.55 | drom | 1.) What is your idea? |
| 20:11.07 | AtsyBoi | empire |
| 20:11.08 | AtsyBoi | xD |
| 20:11.23 | drom | But what kind of empire? |
| 20:11.51 | drom | Like, a brief description or one single sentence you think describes your empire the best |
| 20:12.13 | drom | For example |
| 20:12.34 | AtsyBoi | hmm |
| 20:13.11 | drom | Hegemonic squids that love to declare war on everyone and leadership is taken through violence. |
| 20:13.32 | AtsyBoi | HNG |
| 20:13.40 | AtsyBoi | nope.avi |
| 20:15.01 | drom | You want a space nation. Yes? |
| 20:15.13 | AtsyBoi | Diplomatic space marsupials |
| 20:15.30 | drom | nods |
| 20:16.08 | drom | 2.) What are the founding/founder species, or the primary ruler species? |
| 20:16.40 | AtsyBoi | idk what to call it |
| 20:17.13 | drom | What are they like anyway? |
| 20:17.32 | AtsyBoi | Basically, kangaroos |
| 20:17.40 | drom | Like. blah, blah. Furry, scaly, slimy, or rubber forehead humanoids |
| 20:17.42 | drom | Oh right. |
| 20:18.02 | drom | Since you lack a name for them. I am going to move to an other question |
| 20:18.07 | AtsyBoi | Furry, yeah |
| 20:18.11 | AtsyBoi | Mhm? |
| 20:18.21 | drom | 3.) What is the planet like, and what is its name, if any? |
| 20:18.28 | drom | Planet, as in homeworld |
| 20:19.07 | AtsyBoi | [thinking] |
| 20:20.08 | drom | Usually, when I want to make an empire. The very first thing I make are the species, then the planet. Then a brief history and then the empire itself. |
| 20:20.16 | AtsyBoi | Small gas giant moon, Sarilla |
| 20:20.36 | drom | Since the empire is usually a manifestation of the founder/ruling species' own interests or traits. |
| 20:22.52 | drom | Like, if the species like to fight, expect their empire to be a kleptocracy (leadership taken through violence - coups and assissnations with a claim on the leader position, are considerably an everyday food there) |
| 20:23.04 | drom | that often jumps into wars |
| 20:23.04 | AtsyBoi | Hm |
| 20:24.43 | AtsyBoi | Diplomat empire, but ^^^ |
| 20:26.18 | drom | Keep in mind that what I had feed you are examples, you are free to go crazy and creativie how much you like to |
| 20:26.44 | drom | Although keep in mind it is easier to have a kind of reason WHY and HOW the empire is like this |
| 20:27.37 | AtsyBoi | Ok |
| 20:27.57 | AtsyBoi | So, since i'm a visual learner, is there a things to do/not do page? |
| 20:28.30 | drom | http://spore.wikia.com/wiki/SporeWiki:Fiction_Guidelines/Bad_Starter_Example |
| 20:28.38 | AtsyBoi | Thanks |
| 20:28.46 | drom | the old classic from Technobliterator's inner childhood |
| 20:29.28 | drom | For the good example one, consult this one posted below |
| 20:29.28 | drom | http://spore.wikia.com/wiki/SporeWiki:Fiction_Guidelines/Good_Starter_Example |
| 20:32.52 | AtsyBoi | i want to make another guideline one |
| 20:32.57 | drom | AtsyBoi: And there is an archive of other empires the community has considered to be of good quality and worthy to be featured at the first page |
| 20:32.58 | AtsyBoi | i'm good at jokes |
| 20:32.58 | drom | http://spore.wikia.com/wiki/SporeWiki:Featured_Articles#Featured_Empires |
| 20:33.03 | AtsyBoi | Ok |
| 20:36.21 | drom | AtsyBoi, you are free to make one such empire. But keep in mind not everyone thinks it is necessary. Or an rude act stomping on toes at worst. |
| 20:36.51 | AtsyBoi | As in SW:FG/BSE 2 |
| 20:37.17 | *** join/#sporewiki Methanogen (79dacdc7@gateway/web/freenode/ip.121.218.205.199) |
| 20:37.22 | AtsyBoi | Hi |
| 20:37.36 | drom | Hello |
| 20:37.50 | Methanogen | Hello |
| 20:44.50 | AtsyBoi | ~break ice |
| 20:44.50 | infobot | ACTION installs Windows into ice's brain, reboots it, adds more Microsoft products, and reboots again. |
| 20:45.59 | Methanogen | That's certainly an interesting way to break ice |
| 20:46.08 | Methanogen | Most people would just smash it with a sledgehammer |
| 20:47.28 | drom | Ugh, this is not how you break ICE damnit |
| 20:48.10 | drom | Stupid washed up data cowboys |
| 20:48.20 | AtsyBoi | ~lol |
| 20:48.20 | infobot | somebody said lol was stands for Laughing Out Loud. It is grammatically incorrect to use LOL in the first person; use 'heh' or 'haha' instead. If you want to use LOL, do '/me lol' instead. |
| 20:48.57 | Methanogen | I am not very familiar with data stuff |
| 20:49.19 | drom | https://en.wikipedia.org/wiki/Neuromancer |
| 20:49.48 | Monet | Yeehaw |
| 20:49.56 | Monet | Into Cyberspace we go! |
| 20:50.04 | drom | Basically |
| 20:50.43 | AtsyBoi | rides a computer virus into a PC |
| 20:50.47 | Methanogen | Ah I see |
| 20:50.49 | drom | Also, have one tip, from my experience |
| 20:51.11 | drom | Do not use the ~ commands when not necessary |
| 20:51.18 | drom | Most of the people here find it annoying |
| 20:51.29 | Methanogen | *activates firewall* |
| 20:51.45 | Monet | "[he] died, he contracted a rather nasty case of Plot" - need to remember that line net time I encounter plot-induced death. |
| 20:51.48 | Methanogen | I have a tendency to use asterisks for this sort of thing for some reason |
| 20:51.58 | Methanogen | Haha |
| 20:52.06 | Methanogen | Aren't all fictional deaths plot induced? |
| 20:52.34 | AtsyBoi | SHIT |
| 20:52.36 | AtsyBoi | dies |
| 20:53.15 | Monet | Its the convenient Obi-Wan like plot deaths that are tiring. |
| 20:53.30 | Monet | "I am going to die now so you can carry on" |
| 20:53.37 | Methanogen | Ah |
| 20:53.43 | Methanogen | Usually living helps more |
| 20:54.05 | Monet | https://s-media-cache-ak0.pinimg.com/736x/88/41/26/884126691d1170d56f4acf5c839c8cbf.jpg |
| 20:54.06 | Methanogen | *revives Atsyboi* |
| 20:54.25 | Methanogen | Haha |
| 20:54.46 | AtsyBoi | I AM BECOME VIRUS, DESTROYER OF COMPUTERS |
| 20:56.20 | Methanogen | Aaaah no |
| 20:56.21 | drom | Monet: "I am going to die of age, carry on" |
| 20:56.58 | Methanogen | *deletes Atsyboi* |
| 20:59.47 | Monet | <PROTECTED> |
| 21:00.06 | Monet | <PROTECTED> |
| 21:00.27 | drom | Monet: Ð²Ð¾Ñ Imperios, мои ÑÑка. |
| 21:00.41 | Imperios | ТЫ ÐÐÐÐ ÐÐÐÐÐРСУÐÐРУÐÐÐ |
| 21:00.45 | Monet | <PROTECTED> |
| 21:01.26 | OluapPlayer | No wonder Ryder is smiling when they tell the others he's dead then |
| 21:02.30 | drom | Imperios: Я |
| 21:02.43 | Imperios | So how is the plot in Andromeda? |
| 21:04.03 | Monet | In the early hours it's well I guess mediocre. |
| 21:04.12 | drom | Imperios: I did call you a bitch of mine. |
| 21:04.30 | Monet | Our protagonist has daddy issues, as it turns out. |
| 21:04.58 | Imperios | I heard rumours that Leviathans are involved later on |
| 21:05.03 | Imperios | But these are just rumours |
| 21:05.25 | Methanogen | I have no idea of what any of this is |
| 21:05.42 | drom | I am trying to learn Russian |
| 21:06.26 | OluapPlayer | Mass Effect |
| 21:06.30 | Monet | There's Precursor Tech |
| 21:06.30 | OluapPlayer | Videogame series |
| 21:06.54 | Methanogen | Ahhh I haven't really played that one |
| 21:06.57 | Monet | Also turns out we're only centuries after the events of the Trilogy though crysoleep |
| 21:07.08 | Monet | The arks launch in -2183- |
| 21:07.23 | drom | Imperios: I kind of find it funny how you do not explicitly use "is" or "are" in Russian |
| 21:07.29 | Monet | And Daddy remembers the First Contact War. |
| 21:07.48 | drom | Like |
| 21:07.58 | drom | Father is at the cafe |
| 21:08.24 | drom | папа в каÑе |
| 21:08.33 | drom | Father in cafe |
| 21:09.30 | Methanogen | Does Russian have words like are and stuff? Some languages don't but I'm guessing Russian does just making sure |
| 21:09.35 | Imperios | We do |
| 21:09.42 | Imperios | We just do not use them, though they are implied |
| 21:09.57 | Imperios | Old Russian used them a lot more so they are preserved in archaic phrases, as well as for emphasis |
| 21:10.08 | Methanogen | Ah |
| 21:10.30 | Imperios | For example "Ðз еÑÐ¼Ñ ÑаÑÑ" |
| 21:10.31 | drom | My next problem about Russian is going to be remember all these basic words |
| 21:10.38 | Imperios | Az is Old Church Slavonic for "I" |
| 21:10.45 | Imperios | ÑаÑÑ is tsar |
| 21:10.51 | Imperios | еÑÐ¼Ñ is "am" |
| 21:10.51 | drom | Man |
| 21:11.20 | Imperios | Sometimes the word "ÑÑо", or "this" is used |
| 21:11.25 | drom | Sometimes Russian is way to similar to some European languages |
| 21:11.27 | Methanogen | I'm just going to stick to English.. |
| 21:11.28 | Imperios | Like in French |
| 21:11.34 | Imperios | "L'etat, c'est moi" |
| 21:11.39 | Imperios | "ÐоÑÑдаÑÑÑво - ÑÑо Ñ" |
| 21:12.03 | Imperios | "The State (there) is me" |
| 21:12.34 | Imperios | "ÑÑо" is usually used when connecting two nouns together |
| 21:12.38 | Monet | Watching Andromeda footage is tempting me into playing Civ Beyond Earth again |
| 21:12.53 | drom | Imperios. ryuk = back? |
| 21:12.59 | Imperios | ÑÑк? |
| 21:13.02 | Imperios | There's no such word |
| 21:13.08 | Imperios | Ñпина is the word |
| 21:13.14 | Imperios | For example, "ÐÑÑин - ÑÑо бог" |
| 21:13.22 | Imperios | "Putin is God" |
| 21:13.34 | Imperios | But you can also say "ÐÑÑин бог" |
| 21:13.37 | Imperios | And it will mean the same |
| 21:14.37 | Monet | I'm tempted towards playing either as Kozlov and building the Imperium of Man or Elodie and creating a mechanical utopia. |
| 21:14.50 | drom | ÑÑкзáк |
| 21:14.57 | drom | backpack |
| 21:15.25 | Imperios | Oh |
| 21:15.37 | Imperios | That's not a native Russian word |
| 21:15.48 | Imperios | It's Germanic in origin |
| 21:15.50 | Imperios | "ruck-sack" |
| 21:16.03 | Methanogen | I have to go |
| 21:16.19 | drom | Thought so |
| 21:16.22 | drom | Just like |
| 21:16.26 | drom | Ñадио |
| 21:16.29 | drom | моÑÐ¾Ñ |
| 21:16.36 | drom | мама |
| 21:16.38 | drom | папа |
| 21:19.21 | Imperios | https://en.wiktionary.org/wiki/Rucksack there you go |
| 21:20.04 | Monet | <PROTECTED> |
| 21:20.18 | Imperios | holy fuck |
| 21:20.30 | Imperios | Apparently the word "sack" literally has Ancient Egyptian origins |
| 21:21.07 | Imperios | drom: Ryggsäck |
| 21:21.28 | drom | Yep |
| 21:21.35 | drom | Magsäck |
| 21:21.38 | drom | Matsäck |
| 21:21.43 | Imperios | From Middle English sak (âbag, sackclothâ), from Old English sacc (âsack, bagâ) and Old English sæcc (âsackcloth, sackingâ); both from Proto-Germanic *sakkuz (âsackâ), from Latin saccus (âlarge bagâ), from Ancient Greek ÏÎ¬ÎºÎºÎ¿Ï (sákkos, âbag of coarse clothâ), from Phoenician, Ancient Egyptian ð·ðð (sAq, âsackâ) |
| 21:21.48 | Imperios | Fucking sacks |
| 21:21.56 | drom | Nötsäck |
| 21:22.14 | drom | Kulsäck |
| 21:28.06 | Imperios | drom Monet: https://2ch.hk/po/src/21574938/14904715763530.webm Cooking with Syrians |
| 21:30.31 | drom | 10/10 |
| 21:33.42 | drom | Imperios: Then you have derivates like "säcke" "socka" |
| 21:34.55 | Monet | Imperios: "It's just like pizza, but happier" |
| 21:35.40 | Imperios | drom: >socka |
| 21:35.41 | Imperios | BROTHERS |
| 21:36.53 | drom | you fucking socka blyat |
| 21:38.15 | *** join/#sporewiki Treebeard (5205d1a8@gateway/web/freenode/ip.82.5.209.168) |
| 21:38.17 | Treebeard | Hello |
| 21:38.56 | drom | Atsy|Videos: If ya don't mind me distrupting you for a second. How is your empire doing? |
| 21:41.09 | drom | Imperios: If you are wondering how we Swedes say "bitch" |
| 21:41.18 | drom | There are like two ways to do that |
| 21:41.42 | Imperios | Hm? |
| 21:41.47 | drom | "fitta" (technically either 'pussy' and 'vagina') and "hora" |
| 21:42.00 | Monet | <PROTECTED> |
| 21:42.02 | drom | the latter translating as "whore" |
| 21:42.20 | drom | Monet: That and jihad to spice it up |
| 21:43.00 | Monet | <PROTECTED> |
| 21:43.56 | drom | Imperios, noooooo. |
| 21:45.26 | drom | Monet: I was waiting for Wormy and Xho to post this. But I gonna give it up. http://i.imgur.com/JGju26j.gifv |
| 21:45.36 | drom | this to them* |
| 21:46.22 | Monet | Awww |
| 21:56.42 | drom | Why are these kits so ridiculously cute |
| 21:58.18 | Monet | They're like puppies |
| 22:00.16 | drom | It also helps it has the behaviour of cats and dogs bastardized in one fine package. |
| 22:00.50 | drom | Monet Tek0516: https://cdn.discordapp.com/attachments/269434270190272512/295315735180214277/unknown.png |
| 22:01.09 | Tek0516 | O.o |
| 22:01.50 | Monet | Oh yeah there was a thing where people realised baby porcupines look like a Niffler from Fantastic Beasts. |
| 22:04.13 | Monet | https://www.mumsnet.com/uploads/talk/201606/large-737188-13450267-10154301184994846-4813284213533264926-n.jpg |
| 22:05.47 | AtsyBoi | what did i miss? |
| 22:18.09 | *** join/#sporewiki Liquid_Ink (79d0cd9d@gateway/web/freenode/ip.121.208.205.157) |
| 22:24.50 | *** join/#sporewiki AtsyBoi (415d905e@gateway/web/freenode/ip.65.93.144.94) |
| 22:26.57 | drom | AtsyBoi: I tried pinging you asking about if you have got an idea how to get started with the page? |
| 22:30.01 | AtsyBoi | did ya see my name |
| 22:30.08 | AtsyBoi | i was watching videos |
| 22:31.28 | drom | No shiet |
| 22:33.57 | AtsyBoi | so |
| 22:34.06 | AtsyBoi | DIPLOMATIC SPACE MARSUPIALS |
| 22:34.40 | drom | Kangroos from a moon orbiting a gas giant |
| 22:34.50 | drom | AND ITS NAME IS |
| 22:35.07 | drom | Sarilla |
| 22:35.40 | AtsyBoi | John Cena* |
| 22:35.50 | drom | If you still hadn't turn up with a name for your species. I suggest taking your planet's name and put it in a fashion similar to how you call people by their nationality |
| 22:35.50 | AtsyBoi | jkjkjkjkjkjkjk |
| 22:36.26 | drom | Such as Sarillian, Sarillan, Sarillanei |
| 22:36.30 | drom | Up to you |
| 22:37.16 | drom | For your empire name. I suggest taking the name of its capital world or homeworld |
| 22:37.26 | drom | Or the name of the star system the empire's capital resides in |
| 22:37.36 | drom | And put on other words like |
| 22:37.50 | AtsyBoi | Sarilla will be the gas giant, sarillia will be the moon *clap* |
| 22:37.50 | drom | Empire, Hegemony, etcetera |
| 22:38.27 | drom | Or a common name due to reputation |
| 22:38.28 | drom | Like |
| 22:38.40 | AtsyBoi | So the sarillian empire i guess |
| 22:38.41 | AtsyBoi | xD |
| 22:38.49 | drom | "The Diplomatic Space of Sarillia" |
| 22:38.59 | drom | Uh, I was wrong |
| 22:39.02 | AtsyBoi | xD |
| 22:39.19 | drom | Well I settle down on "The Diplomatic Empire" |
| 22:39.30 | drom | e.g. when there are no empire like it |
| 22:39.41 | drom | Which is unlikely to be |
| 22:53.10 | AtsyBoi | [Quit: drom] |
| 23:04.24 | AtsyBoi | ~kill the ice |
| 23:04.24 | infobot | ACTION shoots a ionized pseudotachyon gun at the ice |
| 23:07.53 | *** join/#sporewiki Tybusen (4405aee9@gateway/web/freenode/ip.68.5.174.233) |