| 00:01.20 | Cyrannian | http://images3.wikia.nocookie.net/__cb20120130183254/spore/images/e/e0/Ktrn_V201.png - Dino has a bunny gurl |
| 00:02.22 | Hachi_ | Hachi - :3 |
| 00:02.25 | Cyrannian | I ship her and Hachi |
| 00:02.39 | Hachi_ | yey |
| 00:05.49 | Cyrannian | On Hachi's relations: Clericarch Iovera - I wanna visit her "valley of the gods". |
| 00:05.52 | Cyrannian | I lol'd |
| 00:06.06 | Hachi_ | olol |
| 00:07.09 | Cyrannian | We have a similar one in Ireland: I wouldn't mind taking a dip in her pot of gold |
| 00:07.40 | Hachi_ | Oh dear lawd |
| 00:09.04 | Hachi_ | dips in OluapPlayer's pot o' gold |
| 00:10.51 | Cyrannian | cringes |
| 00:11.45 | Cyrannian | http://images.wikia.com/spore/images/5/55/Battle_of_Ramhall_06.png - unexpected buttsecks |
| 00:12.07 | Hachi_ | ohgod |
| 00:12.36 | OluapPlayer | Hachi_: wat |
| 00:12.44 | Hachi_ | wuv joo |
| 00:14.39 | Cyrannian | http://images.wikia.com/spore/images/e/e7/Wedding_Happy_End.png - Someone just yelled "Who wants cocaine?!'' |
| 00:15.18 | Hachi_ | ohgodlol |
| 00:16.34 | OluapPlayer | nu |
| 00:18.53 | Cyrannian | http://images1.wikia.nocookie.net/__cb20120522015028/spore/images/3/3a/Zargoth.png - I CANT SEE SHIT |
| 00:19.34 | OluapPlayer | dum |
| 00:21.57 | Cyrannian | Zargoth is an unusual villain. |
| 00:22.16 | Hachi_ | Kol is just plain disturbing |
| 00:23.42 | OluapPlayer | Unusual? |
| 00:24.56 | Cyrannian | Yes, he uses capital locks |
| 00:25.10 | Hachi_ | hur |
| 00:25.19 | OluapPlayer | dum that's not an unusual trait |
| 00:26.15 | Cyrannian | Well, main antagonists generally use formal language, but he doesnt |
| 00:27.14 | Hachi_ | OlaupPlayer: Your page is done |
| 00:27.22 | OluapPlayer | <3 |
| 00:29.24 | Hachi_ | If you want anything else, just ask |
| 00:30.40 | OluapPlayer | b less dum |
| 00:30.42 | OluapPlayer | huhu |
| 00:30.50 | Hachi_ | huehuehuehue |
| 00:31.32 | OluapPlayer | http://spore.wikia.com/wiki/Planet:Macronormus look hao preeeeeetty dis is |
| 00:32.50 | Cyrannian | purtu |
| 00:32.53 | Cyrannian | *purty |
| 00:34.20 | Hachi_ | I am proud of dis page |
| 00:36.34 | OluapPlayer | There actually is an Imperator Routrix in that picture |
| 00:36.39 | OluapPlayer | Hdden behind the trees |
| 00:36.42 | OluapPlayer | Hidden even |
| 00:37.17 | Hachi_ | Oh shit |
| 00:38.07 | Cyrannian | Goodbye banana noses. |
| 00:38.19 | Hachi_ | Cya later, stinky face |
| 00:38.32 | Cyrannian | drowns in tears |
| 00:38.37 | OluapPlayer | hur |
| 00:39.36 | Hachi_ | BTW Oluap |
| 00:39.38 | OluapPlayer | Also the group needs a smart guy so Baptarion's gonna join them |
| 00:39.43 | Hachi_ | Gimme a png for one of those Mikmik things |
| 00:39.46 | Hachi_ | Oh yay |
| 00:40.02 | OluapPlayer | nevur |
| 00:40.10 | Hachi_ | I'm glad to hear Bap is coming along. |
| 00:40.40 | OluapPlayer | Time to use those archeologist skills |
| 00:41.06 | OluapPlayer | http://static.spore.com/static/thumb/500/897/333/500897333392.png |
| 00:41.12 | OluapPlayer | http://static.spore.com/static/thumb/500/897/339/500897339855.png |
| 00:41.17 | OluapPlayer | http://static.spore.com/static/thumb/500/897/339/500897339858.png |
| 00:41.21 | OluapPlayer | http://static.spore.com/static/thumb/500/897/339/500897339862.png |
| 00:41.41 | Hachi_ | I only needed one hur |
| 00:42.00 | OluapPlayer | <PROTECTED> |
| 00:42.10 | OluapPlayer | You'll have all of them and you'll like it |
| 00:46.34 | OluapPlayer | Hachi_: http://www.youtube.com/watch?v=_ykbVt1ZaJM |
| 00:47.54 | Hachi_ | Funny cuz I've seen the original scene hur |
| 00:50.28 | OluapPlayer | Kaptan Farukonda |
| 00:50.35 | OluapPlayer | That's how I listen to it hur |
| 00:53.37 | Hachi_ | A Dota2 anime would be epic |
| 00:53.47 | Hachi_ | But then again, I think anime is epic anyway hur |
| 00:57.04 | *** join/#sporewiki WorkingJ_ (~OfficerJa@217.sub-70-193-203.myvzw.com) |
| 00:57.53 | *** join/#sporewiki OfficerJackal (~OfficerJa@217.sub-70-193-203.myvzw.com) |
| 00:58.01 | OfficerJackal | Dum. |
| 00:58.12 | OfficerJackal | ~test |
| 00:58.12 | infobot | ACTION hunts officerjackal down and lays eggs in his digestive system |
| 01:16.11 | WorkingJackal | Tablet battery is going to die, see you all later! |
| 02:11.12 | Aeo | test |
| 02:15.01 | Hachi_ | brb |
| 02:17.56 | Hachi_ | Aaaand back |
| 02:19.21 | OluapPlayer | And I'm ded, bai |
| 02:20.27 | Hachi_ | nu |
| 02:47.16 | *** join/#sporewiki Aeo (3253b7b1@gateway/web/freenode/ip.50.83.183.177) |
| 03:01.09 | *** join/#sporewiki OfficerJackal (~thomaspal@c-69-139-59-13.hsd1.fl.comcast.net) |
| 03:01.30 | OfficerJackal | Hey everybody! |
| 03:56.40 | OfficerJackal | ~test |
| 03:56.40 | infobot | ACTION hunts officerjackal down and lays eggs in his digestive system |
| 03:58.53 | *** join/#sporewiki OfficerJackal (~thomaspal@69.139.59.13) |
| 04:00.40 | OfficerJackal | Internet=DUM |
| 04:02.58 | Tybusen | the internet loves you too |
| 04:05.01 | Aeo | <PROTECTED> |
| 04:05.49 | OfficerJackal | <PROTECTED> |
| 04:05.55 | OfficerJackal | SPAM. |
| 04:09.31 | Tybusen | MAPS. |
| 04:12.53 | *** join/#sporewiki OfficerJackal_ (~thomaspal@c-69-139-59-13.hsd1.fl.comcast.net) |
| 04:13.08 | OfficerJackal | Well, that was dum, I haz power outage. |
| 04:14.32 | *** join/#sporewiki Angrybirds (47ca15d9@gateway/web/qwebirc/irc.wikia.com/ip.71.202.21.217) |
| 04:16.43 | Aeo | ~Aeo |
| 04:16.43 | infobot | hmm... aeo is a shrew |
| 04:20.05 | OfficerJackal | ~test |
| 04:20.05 | infobot | ACTION hunts officerjackal down and lays eggs in his digestive system |
| 04:24.52 | Aeo | http://spore.wikia.com/wiki/SporeWiki:Fiction_Universe/Universal_Discussion_Board#A_Strange_incident_in_the_Aeoneonatrix_Empire AngryBirds OfficerJackal |
| 04:25.19 | OfficerJackal | Lol wtf. |
| 04:25.56 | OfficerJackal | Sounds like something Galak would do :/ |
| 04:39.44 | *** join/#sporewiki Angrybirds (47ca15d9@gateway/web/qwebirc/irc.wikia.com/ip.71.202.21.217) |
| 04:39.55 | Angrybirds | ... How did this make its way on to the UDB? xD |
| 04:43.49 | Angrybirds | Aeo |
| 04:44.43 | Aeo | It just happened to |
| 04:44.57 | Aeo | If you mean why did it in canon |
| 04:45.20 | Angrybirds | I meant, why did you put it up there. What purpose does it serve? |
| 04:45.39 | Aeo | Its funny |
| 04:45.49 | Aeo | Or... confusing |
| 04:54.31 | Angrybirds | Okay. Does it further a plot? |
| 04:58.08 | Aeo | well it will introduce the Aeon gangsters |
| 05:05.39 | Angrybirds | Ah. |
| 05:06.39 | Aeo | That is what REAL Aeon drugs make you do |
| 05:10.52 | Angrybirds | I see. |
| 05:12.42 | Aeo | Just like bath salts for humans |
| 05:18.17 | Tybusen | The title Through the Wormhole makes me expect Morgan Freeman to unexpectedly pop up in the middle of the war. |
| 05:19.11 | Aeo | That's who finally kills the Xhodocto |
| 05:19.16 | Aeo | Morgan Freeman. |
| 05:21.15 | Angrybirds | Why does that remind you of Morgan Freeman? xD |
| 05:22.42 | OfficerJackal | The TV show on the Science Channel |
| 05:22.53 | OfficerJackal | Through the Wormhole: With Morgan Freeman. |
| 05:23.06 | Angrybirds | Ah. |
| 05:23.41 | Tybusen | It almost seemed like it was supposed to be a reference to that show :U |
| 05:23.44 | Tybusen | I blame GD |
| 05:26.37 | Angrybirds | lulz. Yep, he came up with it. |
| 05:28.01 | MorganFreeman | Did somebody mention me? |
| 05:28.39 | OfficerJackal | Agh, I was going to do it poorly anyways :/ |
| 05:30.08 | MorganFreeman | The common Dominatus makes its way across the Katar Sector during the harsh winter, in search of Aeoneonatrix to consume. It will be a long march for the Dominatus to the sea and back. Yet they do this every mating season. |
| 05:31.35 | MorganFreeman | No one knows why they do this. The answers can only be found... through the wormhole. |
| 05:31.46 | MorganFreeman | *Star Trek theme plays* |
| 05:31.52 | Tybusen | Oops, wrong soundtrack |
| 05:33.11 | OprahWinfry | Yup, it's actually a good show. |
| 05:44.34 | Angrybirds | Night people. |
| 06:40.22 | *** join/#sporewiki heytheresexy (79362259@gateway/web/freenode/ip.121.54.34.89) |
| 06:40.31 | OfficerJackal | Wut. |
| 06:44.19 | R17 | nuffing |
| 06:45.31 | Aeo | gets on Tybusen's lap |
| 06:45.51 | Aeo | and asks Tybusen for shrew treats. |
| 06:46.33 | Tybusen | gives Aeo dog treats instead |
| 06:46.39 | Tybusen | eat up |
| 06:47.08 | Aeo | noms the dog treats. |
| 06:47.25 | Aeo | Errr.... Why do you not have shrew treats on hand? |
| 06:47.29 | *** join/#sporewiki EmperorsWrath (~yaaic@host-139-156-66-217.spbmts.ru) |
| 06:47.32 | Tybusen | Impy |
| 06:47.33 | EmperorsWrath | Hi |
| 06:47.40 | EmperorsWrath | Ty M |
| 06:47.43 | Tybusen | y u no update Divirats relations page |
| 06:47.43 | EmperorsWrath | Ty? |
| 06:47.50 | EmperorsWrath | Ah yes |
| 06:47.57 | R17 | Hurro Empeh |
| 06:48.23 | EmperorsWrath | BTW what's the name of the TIAF capital world in Andromeda |
| 06:48.41 | Tybusen | Alarcon. |
| 06:50.22 | Tybusen | And if you want the names of any other major planets in TIAF Andromeda, there's Boano and Stafamur. |
| 06:50.26 | Tybusen | Anyways |
| 06:50.31 | Tybusen | I must be going to bed soon |
| 06:50.34 | Tybusen | See ya'll later |
| 06:51.28 | R17 | good gosh for some reason I keep hearing that "squee" sound from MLP outside |
| 06:52.35 | Aeo | The Ponies are coming for you R17 |
| 06:52.48 | R17 | oh god |
| 06:52.51 | Aeo | THEY'RE COMING FOR YOU |
| 06:52.52 | R17 | where are my cuddles |
| 06:52.57 | R17 | I need them |
| 06:53.03 | R17 | to cuddle the ponies |
| 06:53.10 | Aeo | gets on R17 's lap |
| 06:55.29 | R17 | eats Aeo, only to shit him out hours later |
| 06:59.08 | Aeo | bathes |
| 07:47.20 | R17 | I KILLED THE CHAT |
| 07:47.21 | R17 | YES |
| 07:47.23 | R17 | BWAHAHAHA |
| 07:47.34 | R17 | commits suicide as there is nothing else left to do |
| 08:01.14 | OfficerJackal | ~penis |
| 08:01.14 | infobot | i guess penis is something that Technomancer likes to eat |
| 08:01.22 | OfficerJackal | eqpfvbneiopwfghqwe0p8fh2qebfnwoiabf |
| 08:24.57 | *** join/#sporewiki GD12s (31900ebb@gateway/web/freenode/ip.49.144.14.187) |
| 08:25.38 | GD12s | hi |
| 08:27.50 | R17 | tits |
| 08:29.51 | OfficerJackal | Bai everybody. |
| 08:29.52 | OfficerJackal | ~penis |
| 08:29.52 | infobot | extra, extra, read all about it, penis is something that Technomancer likes to eat |
| 08:29.55 | *** part/#sporewiki OfficerJackal (~thomaspal@c-69-139-59-13.hsd1.fl.comcast.net) |
| 08:33.27 | *** join/#sporewiki Liquid_Ink (79d0badc@gateway/web/freenode/ip.121.208.186.220) |
| 08:34.13 | R17 | tots |
| 08:37.00 | *** join/#sporewiki Wormy (d92a9ab0@gateway/web/freenode/ip.217.42.154.176) |
| 08:37.05 | Wormy | hi |
| 08:37.08 | Aeo | hi |
| 08:37.40 | Wormy | Who here watched Thunderbirds when they were a kid |
| 08:38.27 | GD12 | i think i did |
| 08:38.29 | GD12 | hi u |
| 08:39.19 | Wormy | I love the crazy vehicles |
| 08:39.27 | GD12 | Wormy , SW nerdiness has made it into my school, i'm writing a research paper on quantum field theory hur |
| 08:39.43 | Wormy | 40:35 http://www.youtube.com/watch?v=KtN2bgw-2-k |
| 08:39.49 | Wormy | Awesome |
| 08:40.34 | Wormy | GD12 Speaking of of physics http://wormulon.deviantart.com/#/art/Elegant-Dance-of-Physics-357448119?_sid=bb492bd |
| 08:41.10 | Liquid_Ink | I love thunderbirds! |
| 08:41.13 | GD12 | dose equations |
| 08:43.10 | Wormy | I knew you would Liquid_Ink |
| 08:43.41 | GD12 | Wormy you should have put the Schrondinger Equation there |
| 08:43.56 | Liquid_Ink | http://www.chartgeek.com/wp-content/uploads/2012/12/firefly-venn-diagram.jpg |
| 08:44.24 | Liquid_Ink | http://www.chartgeek.com/wp-content/uploads/2012/12/star-trek-characters.png |
| 08:45.36 | Wormy | not enough space to fit lol |
| 08:45.54 | GD12 | hur |
| 08:45.54 | Liquid_Ink | http://www.chartgeek.com/wp-content/uploads/2013/02/cartoon-elements.jpg |
| 08:46.11 | Liquid_Ink | http://www.chartgeek.com/wp-content/uploads/2013/02/jungian-archetypes.png |
| 08:46.31 | GD12 | i wonder whot the least assholish of my characters is |
| 08:47.06 | GD12 | probably mortrig |
| 08:48.57 | Liquid_Ink | http://www.chartgeek.com/wp-content/uploads/2013/01/star-wars-timeline.jpg |
| 08:49.13 | Liquid_Ink | http://www.chartgeek.com/wp-content/uploads/2013/01/star-wars-map.jpg |
| 08:49.24 | Liquid_Ink | http://www.chartgeek.com/wp-content/uploads/2013/01/star-wars-planets.jpg |
| 08:51.07 | GD12 | I feel as if i need to make my army page more comprehensive |
| 08:51.10 | GD12 | time to start adding |
| 08:51.36 | R17 | I've watched Thunderbirds101's Microsoft Sam videos |
| 08:51.39 | R17 | on another note: |
| 08:51.40 | R17 | HOORAH |
| 08:51.43 | R17 | THIS PLACE IS ALIVE AGAIN |
| 08:51.58 | R17 | revives himself from his suicide much earlier |
| 08:55.37 | Wormy | Empire Strikes Back might be my favourite film because it has the badass GE |
| 08:55.56 | GD12 | aye |
| 08:56.00 | GD12 | it really caputres their military might |
| 08:56.56 | Wormy | I still think the GE could curbstomp anyone below Elder-race level like The Culture |
| 08:57.17 | GD12 | GE only ha about 1,000 Star Destroyers i believe |
| 08:57.55 | Wormy | Has more than that, and the GE has millions of other warships |
| 08:58.07 | Wormy | Millions stationed in every sector |
| 08:58.33 | GD12 | hmm |
| 08:58.47 | Wormy | I think they have 25,000 Star Destroyers, which are only icon ships |
| 08:59.25 | GD12 | The Grand Army of the Republic only had several million troopers iirc |
| 09:00.13 | R17 | I still think that the IoM and GE are pretty even |
| 09:00.27 | GD12 | A Sector group only had several thousand ships |
| 09:00.38 | GD12 | http://starwars.wikia.com/wiki/Imperial_Navy#Sector_group |
| 09:01.24 | R17 | though some, if not, most of the other 40k races could probably at least give the GE a pretty hard time |
| 09:01.42 | Wormy | I may have meant oversector |
| 09:01.59 | Wormy | http://starwars.wikia.com/wiki/User:Wormulon#Technological_capability_of_the_Galactic_Empire.2FRepublic |
| 09:02.05 | *** join/#sporewiki AdmiralPanda (3a6b1143@gateway/web/freenode/ip.58.107.17.67) |
| 09:02.30 | Wormy | I have canon evidence the GE possess higher technology than seen in the films |
| 09:02.40 | GD12 | aye, i'm just basing my stoof from the fils |
| 09:02.42 | *** join/#sporewiki AConfusedPanda (3a6b1143@gateway/web/freenode/ip.58.107.17.67) |
| 09:02.49 | GD12 | films didnt follow science, just rule of col |
| 09:03.02 | R17 | Tau and IoM have inferior tech, that's true |
| 09:03.07 | R17 | but Eldar and Necrons.... |
| 09:03.19 | Wormy | http://starwars.wikia.com/wiki/Worldcraft |
| 09:03.20 | GD12 | aye |
| 09:03.30 | GD12 | The forefront of GE tech is quite good |
| 09:03.31 | R17 | IoM from the Dark Age (or before that, maybe?) would stand a better chance than present IoM |
| 09:03.34 | GD12 | still |
| 09:03.35 | GD12 | GUNBUSTER |
| 09:03.43 | R17 | Necrons have World Engines and stuff |
| 09:04.19 | R17 | took an entire Spehss Mahreen chapter or two and several fleets to take one down |
| 09:04.56 | R17 | Eldars have tricky-tricks |
| 09:05.09 | AConfusedPanda | There's no evidence that a second World Engine exists |
| 09:05.32 | R17 | but it's possible... |
| 09:05.59 | Wormy | Worldcraft is probably the best of GE engineering - artificial planets that can travel through hyperspace and leisure homes for important Imperials |
| 09:06.17 | GD12 | aye |
| 09:07.30 | R17 | ANotSoConfusedPanda |
| 09:07.50 | GD12 | A long long time ago in a galaxy far far away |
| 09:09.05 | R17 | In the grim darkness of the far future |
| 09:09.21 | GD12 | i wonder what sporewikis catchphrase would be |
| 09:09.30 | GD12 | In the Dark Edginess of the First Gigaquadrant |
| 09:09.45 | GD12 | Dark and Edgy varies by fiction though. |
| 09:09.55 | R17 | "In an alternate reality of variety" |
| 09:10.06 | R17 | that would be SporeWiki's catchphrase, I think? |
| 09:10.08 | R17 | Wormy |
| 09:10.16 | R17 | think of a good catchphrase/tagline for SporeWiki |
| 09:10.39 | R17 | https://fbcdn-sphotos-g-a.akamaihd.net/hphotos-ak-prn1/522504_417555651668117_1072125675_n.jpg pure awesome |
| 09:10.55 | R17 | cuz everyone loves gorillas right? |
| 09:12.03 | Wormy | lol |
| 09:12.04 | GD12 | I've finished making descriptions for the overseers, finally =P |
| 09:12.11 | GD12 | Time to make Dominatus versions of epics |
| 09:12.13 | Wormy | I don't know bout catchphrase |
| 09:12.49 | GD12 | Gonna have three types of epics |
| 09:12.49 | R17 | https://fbcdn-sphotos-b-a.akamaihd.net/hphotos-ak-ash3/526497_450944634959695_1566092003_n.jpg |
| 09:12.58 | GD12 | and i may crossover with starwars for one of them |
| 09:14.45 | R17 | For some reason |
| 09:14.52 | GD12 | the sarlaac of star wars that is |
| 09:15.43 | R17 | I keep getting the feel that more sleek and technological and flashy = less grimdark (except for Eldar, who drop out on the last bit, and live in a grimdark universe) |
| 09:16.36 | GD12 | i personally like streamlined designs |
| 09:18.55 | R17 | Old, battle-scarred and bulky/boxy is the IoM's schtick in aesthetics, and I think it really gives the feeling of grimdark pretty well |
| 09:19.29 | R17 | I wanna' do a similar design with Xarikverse Humans yet still give off a good bit of technological looks. |
| 09:21.04 | *** join/#sporewiki Wormy (d92a9ab0@gateway/web/freenode/ip.217.42.154.176) |
| 09:21.25 | R17 | Though tbh, I often get the feel that sleek and shiny with lots of glowy lights has no place in a dark and gritty setting. |
| 09:21.51 | GD12 | yo |
| 09:21.54 | GD12 | as I was saying |
| 09:22.05 | GD12 | Dominatus bioengineering is carrying over to three epics |
| 09:22.11 | GD12 | one of which will mix with star wars |
| 09:23.56 | AConfusedPanda | The other two will mix with muffins |
| 09:24.05 | GD12 | hur |
| 09:24.37 | R17 | GUD IDEA |
| 09:24.43 | R17 | no seriously |
| 09:24.47 | R17 | muffins is gud idea |
| 09:24.47 | R17 | jk |
| 09:25.23 | GD12 | These things may be quite powerfuk |
| 09:25.48 | R17 | Radux are quite powerfuk too |
| 09:25.49 | R17 | so it's okay |
| 09:27.01 | GD12 | it will be cool to see hel go through god of war action sequences to kill these things |
| 09:28.17 | Wormy | used to be my favourite extinct order http://spore.wikia.com/wiki/Taxon:Creodonta?rcid=558654 |
| 09:28.27 | AConfusedPanda | You know me so well xD |
| 09:29.21 | R17 | Nightmare Spoon |
| 09:29.44 | GD12 | in fact im set on debuting them when fordanta battle dominatus next |
| 09:38.34 | Wormy | bye |
| 09:40.12 | Aeo | If you could have any of the 4 bending powers, which one would it be? |
| 09:40.26 | R17 | None of them |
| 09:40.30 | R17 | I choose only |
| 09:40.33 | R17 | Reality-Bending |
| 09:41.00 | Aeo | R17: You can't do that |
| 09:41.09 | Aeo | Water, Earth, Fire or Air |
| 09:41.19 | R17 | I can think outside of the box |
| 09:41.25 | R17 | and type anything I can in the interwebz |
| 09:41.27 | R17 | so yes I can |
| 09:41.28 | Aeo | You cannot |
| 09:41.37 | R17 | You're no admin |
| 09:41.44 | Aeo | Yes I am |
| 09:41.56 | Aeo | reveals that he is a reality admin |
| 09:41.57 | R17 | Cool story bro |
| 09:42.06 | R17 | that's just you typing stuff |
| 09:47.45 | AConfusedPanda | ngh dum Riot changing my fave support |
| 10:59.10 | GD12 | ded |
| 10:59.45 | Liquid_Ink | We're all dead on the inside... |
| 11:00.08 | R17 | I'm a murderer |
| 11:00.09 | R17 | muahaha |
| 11:01.10 | R17 | on another note: War of the Worlds is gud series |
| 11:01.20 | R17 | the Martians should have remembered to take their flu shots though |
| 11:01.51 | Liquid_Ink | They did when they attacked Venus. |
| 11:03.06 | GD12 | guys http://images.wikia.com/spore/images/2/24/SubjugatorOfCravidorPortrait.png |
| 11:03.12 | GD12 | first overseer pic ive made in a long time |
| 11:04.33 | R17 | Martians did remember to apply vaccine in the video game adaptation of Jeff Wayne's musical, the catch? The humans weren't as defenseless and pathetic. |
| 11:05.38 | *** join/#sporewiki OluapWorker (b164f883@gateway/web/freenode/ip.177.100.248.131) |
| 11:05.38 | *** mode/#sporewiki [+o OluapWorker] by ChanServ |
| 11:07.23 | GD12 | yo |
| 11:07.54 | OluapWorker | hi |
| 11:08.10 | R17 | http://www.youtube.com/watch?v=I0UjCsZIIOk "My... they have also re-armed themselves... -*SHOT*" |
| 11:20.02 | GD12 | Aeo : Mardor Overseer http://images.wikia.com/spore/images/0/00/HarbingerOfAgonyPortrait.png |
| 11:21.04 | OluapWorker | http://spore.wikia.com/wiki/Planet:Macronormus paeg needs more quotes |
| 11:46.00 | GD12 | test |
| 11:46.53 | R17 | icles |
| 11:54.09 | GD12 | i have only 5 more overseer models to do |
| 12:09.55 | GD12 | R17 http://images.wikia.com/spore/images/8/82/ImpalerOfSkali%27drazPortrait.png |
| 12:10.52 | R17 | I was expecting extra blue |
| 12:11.43 | GD12 | o i c |
| 12:11.52 | GD12 | well thats enough seer models for tonight hur |
| 12:12.05 | GD12 | wait i need to recount |
| 12:12.09 | GD12 | i still have 5 to do |
| 12:12.10 | GD12 | ngh |
| 12:54.18 | *** join/#sporewiki GD12 (31900ebb@gateway/web/freenode/ip.49.144.14.187) |
| 12:54.32 | GD12 | hi |
| 12:54.35 | GD12 | ~seen Monet |
| 12:54.40 | infobot | monet <5b7d5d84@gateway/web/freenode/ip.91.125.93.132> was last seen on IRC in channel #sporewiki, 13h 54m 4s ago, saying: 'Thanks. Bye everyone!'. |
| 12:56.46 | *** join/#sporewiki EmperorsWrath (~yaaic@host-131-157-66-217.spbmts.ru) |
| 12:57.19 | OluapWorker | hello |
| 13:01.10 | *** join/#sporewiki Hachi_ (6d98f0d3@gateway/web/freenode/ip.109.152.240.211) |
| 13:01.12 | Hachi_ | i r dovakiin |
| 13:01.19 | Hachi_ | fus ro dahs OluapWorker |
| 13:01.21 | GD12 | yo |
| 13:01.23 | OluapWorker | mor like dumvakiin |
| 13:01.28 | GD12 | hur |
| 13:01.38 | GD12 | i make u lusty argonian maid |
| 13:01.42 | Hachi_ | nu |
| 13:01.57 | GD12 | den lusty khajit made |
| 13:02.01 | Hachi_ | yey |
| 13:02.02 | GD12 | *maid |
| 13:02.12 | Hachi_ | i r khajit |
| 13:02.24 | Hachi_ | People keep picking on me because I'm a cat in Skyrim |
| 13:02.36 | GD12 | o i c |
| 13:02.37 | Hachi_ | Like, every town I go, people point and stare |
| 13:02.40 | GD12 | hur |
| 13:02.43 | GD12 | den kill dem |
| 13:02.46 | OluapWorker | Hachi_: https://dl.dropbox.com/u/51361672/530898_333094903452063_1769872396_n.jpg |
| 13:02.49 | EmperorsWrath | hi |
| 13:03.05 | Hachi_ | ohgodlol |
| 13:03.09 | Hachi_ | So true |
| 13:04.55 | GD12 | Hachi_ u c the new overseer models i put up? |
| 13:05.01 | Hachi_ | nu |
| 13:05.40 | GD12 | Vartekian one http://images.wikia.com/spore/images/2/24/SubjugatorOfCravidorPortrait.png |
| 13:06.21 | GD12 | grimbo one http://images.wikia.com/spore/images/f/f9/HeraldOfMosivamPortrait.png |
| 13:06.28 | GD12 | groxie http://images.wikia.com/spore/images/c/c6/SteelReaperPortrait.png |
| 13:06.44 | GD12 | mardor (one of aeons creations) http://images.wikia.com/spore/images/0/00/HarbingerOfAgonyPortrait.png |
| 13:06.54 | GD12 | Crystalline http://images.wikia.com/spore/images/8/82/ImpalerOfSkali%27drazPortrait.png |
| 13:07.00 | GD12 | thats all the modles today |
| 13:07.09 | Hachi_ | Dayumn |
| 13:07.12 | GD12 | i have 5 more to make till im done with all of dem |
| 13:07.15 | Hachi_ | I'll admit, pretty impressive |
| 13:07.40 | GD12 | ty |
| 13:13.12 | GD12 | too much dum http://spore.wikia.com/wiki/User_blog:Mur-dorr./major_war_story_idea. |
| 13:14.17 | Hachi_ | This guy is retardum |
| 13:14.59 | GD12 | i think he be trolling |
| 13:15.30 | Hachi_ | I just feel tempted to comment with "Nope". |
| 13:15.51 | OluapWorker | That makes me want to hurt things |
| 13:15.55 | OluapWorker | ~hurt Hachi_ |
| 13:15.55 | infobot | ACTION takes a large hammer and plays whack-the-mole on Hachi_'s hands, laughing all the while |
| 13:16.16 | Hachi_ | cuddles OluapWorker |
| 13:16.50 | GD12 | I try to help out with new fictions before saying that they don't fit in with the ficverse. |
| 13:17.11 | GD12 | I'll only get to the "nope" stage if the continually disregard advice. |
| 13:17.32 | Hachi_ | He disregarded advice last time |
| 13:18.56 | Hachi_ | Also, it's quite obvious "mur-dorr" is based on murder |
| 13:19.03 | GD12 | aye |
| 13:19.15 | GD12 | but its nearly impossible to exhaust my patience hur |
| 13:19.26 | Hachi_ | cuz u fat |
| 13:20.18 | Hachi_ | http://i2.kym-cdn.com/photos/images/original/000/501/176/737.gif Oluap when he looked at that dum blog |
| 13:20.27 | OluapWorker | Yep |
| 13:20.37 | GD12 | hur |
| 13:21.15 | Hachi_ | There should honestly be more vibrating gifs |
| 13:21.37 | Hachi_ | And I mean ones that aren't ponies |
| 13:21.57 | GD12 | hur |
| 13:23.21 | GD12 | i wanna see this doods reply on the blog |
| 13:23.25 | GD12 | or if he gets onto the irc |
| 13:23.37 | OluapWorker | I don't want dum people on IRC |
| 13:23.43 | OluapWorker | oh wait Hachi's already here |
| 13:23.50 | Hachi_ | fuck u biatch |
| 13:23.50 | GD12 | hur |
| 13:24.43 | Hachi_ | I feel tempted to play DmC again but I cannot get over how shitty the characters and story is |
| 13:24.47 | GD12 | hur |
| 13:25.14 | Hachi_ | I mean the gameplay is good but the characters and story dunt really justify the game too much |
| 13:27.23 | Hachi_ | I mean, if you're gonna change the main character, don't change him to the point it's a completely different character |
| 13:28.28 | Hachi_ | Dante went from a white-haired devil-human hybrid with good humour to a rude and cocky black-haired shithead Nephilim |
| 13:29.29 | OluapWorker | Replace him with a Pikmin |
| 13:29.43 | Hachi_ | hur |
| 13:29.49 | Hachi_ | Demon hunting Pikmin |
| 13:29.51 | Hachi_ | Makes sense |
| 13:40.36 | *** join/#sporewiki Jepardi (d5f38d50@gateway/web/freenode/ip.213.243.141.80) |
| 13:40.41 | Jepardi | Hi |
| 13:41.30 | GD12 | hi u |
| 13:56.11 | GD12 | now i have to make vehicles for le dominatus |
| 14:03.51 | GD12 | test |
| 14:03.58 | R17 | finished the Martian Campaign in the video game adaptation of War of the Worlds |
| 14:04.27 | R17 | at least the Martians this time remembered to take their medicine before that |
| 14:04.39 | R17 | next stop: the Artilleryman's brave new world |
| 14:05.07 | Hachi_ | There's a game of it? |
| 14:05.19 | R17 | yes |
| 14:05.22 | R17 | kinda' old |
| 14:05.27 | R17 | 1998 |
| 14:05.37 | R17 | among the first fully 3D games |
| 14:06.51 | R17 | basically Jeff Wayne's musical turned into a game with a twist: the Martians have, as I previously mentioned, remembered to apply vaccine, but the humans actually put up quite a resistance with a proper military force. |
| 14:06.56 | *** join/#sporewiki Wormy (5284ec24@gateway/web/qwebirc/irc.wikia.com/ip.82.132.236.36) |
| 14:07.08 | Wormy | hello |
| 14:07.31 | OluapWorker | http://i.imgur.com/fJz7alX.jpg Humanity |
| 14:07.59 | Wormy | connection test |
| 14:08.16 | Wormy | hoorah this works |
| 14:08.58 | GD12 | hello Wormy |
| 14:09.09 | GD12 | did u see the grimbo overseer? |
| 14:09.24 | Wormy | i can now access irc whereever i want |
| 14:09.25 | R17 | http://www.youtube.com/watch?v=3D0womf-piQ |
| 14:09.34 | R17 | http://www.youtube.com/watch?v=I0UjCsZIIOk |
| 14:09.42 | GD12 | look at dat http://images.wikia.com/spore/images/f/f9/HeraldOfMosivamPortrait.png |
| 14:09.53 | Wormy | i haven't, show me |
| 14:09.55 | GD12 | I have 5 more overseer models to make and one to refurbish tommorow |
| 14:10.01 | GD12 | i've lineked you hur |
| 14:10.28 | R17 | GD12 is Crystallseer quadrupedal? |
| 14:10.55 | GD12 | Only bipedal |
| 14:10.57 | GD12 | but 4 arms |
| 14:11.18 | R17 | I sees |
| 14:11.18 | GD12 | Wormy u c the overseer nao? |
| 14:11.31 | R17 | make him quadruped if possible and all blue |
| 14:11.31 | Wormy | sorry, loading is poor |
| 14:11.37 | GD12 | k |
| 14:11.43 | GD12 | alright, i'll try tommorow |
| 14:11.57 | GD12 | In addition to that I've finally finished adding every unit in my head to dominatus army page |
| 14:12.11 | GD12 | all i have to do now is make models and fill in details |
| 14:12.39 | OluapWorker | http://25.media.tumblr.com/e3e6aa4e1dcd478665f13bbdbf810d1e/tumblr_mgvijkwMpq1qed41xo1_400.gif "Get out Sonic, you're in my way" |
| 14:12.39 | GD12 | I have a total of 25 types of vehicles dere nao |
| 14:13.12 | GD12 | gonna be quite a bit of work to fill that in |
| 14:13.12 | *** join/#sporewiki Wormy_ (5284ec24@gateway/web/qwebirc/irc.wikia.com/ip.82.132.236.36) |
| 14:13.28 | Wormy_ | it works now |
| 14:13.47 | GD12 | cool |
| 14:13.49 | GD12 | so u c link? |
| 14:15.11 | GD12 | here if you need it again http://images.wikia.com/spore/images/f/f9/HeraldOfMosivamPortrait.png |
| 14:15.18 | OluapWorker | http://i.imgur.com/xOeaHSg.jpg HUH |
| 14:15.53 | Wormy_ | test |
| 14:16.02 | GD12 | confirmed |
| 14:17.03 | Wormy_ | wow the armour is amazing |
| 14:17.03 | Wormy_ | test |
| 14:17.21 | OluapWorker | http://25.media.tumblr.com/tumblr_lr6pxst4V01qb9vz6o1_500.png |
| 14:17.47 | Hachi_ | ohgodlol |
| 14:18.26 | GD12 | thanks |
| 14:18.43 | Wormy_ | i ceen |
| 14:19.29 | EmperorsWrath | GD12: How many overseers do you have |
| 14:19.43 | OluapWorker | https://sphotos-b.xx.fbcdn.net/hphotos-frc1/21917_609295525753759_880143267_n.jpg |
| 14:20.07 | GD12 | hur i've capped out at 24, i've put it there so it goes from alpha to omega |
| 14:20.14 | GD12 | cuz 24 letters ingreek alphabet |
| 14:21.00 | OluapWorker | Hachi_: http://i.imgur.com/ElFOMwg.jpg |
| 14:21.34 | Hachi_ | That's exactly that |
| 14:21.35 | EmperorsWrath | GD12: That's a lot |
| 14:21.52 | GD12 | aye |
| 14:22.26 | Wormy_ | brb while i get off train |
| 14:26.03 | OluapWorker | http://i.imgur.com/72jrv8J.gif See ya later shitlords |
| 14:27.58 | *** join/#sporewiki Wormy_ (5284ec24@gateway/web/qwebirc/irc.wikia.com/ip.82.132.236.36) |
| 14:28.05 | GD12 | yo |
| 14:28.10 | Wormy_ | hi gain |
| 14:28.55 | Wormy_ | i no longer have to wait 25 to 40 mins bored waiting for my next train |
| 14:29.00 | GD12 | and now i notice my army page has 66 distinct units |
| 14:29.02 | GD12 | hur |
| 14:29.52 | OluapWorker | http://24.media.tumblr.com/beb74ddcd0e290ee7a27e87ea0e83d39/tumblr_mies75ngbW1qcz9uwo1_1280.jpg General 10 year old insults |
| 14:29.54 | Wormy_ | tet |
| 14:30.21 | GD12 | confirmed |
| 14:30.45 | Hachi_ | ohgod |
| 14:31.54 | Wormy_ | remembers when he blocked te 8 year old from sprewiki and he thretened to block me |
| 14:32.31 | Wormy_ | test |
| 14:32.45 | GD12 | hur |
| 14:33.04 | OluapWorker | quit ur testin |
| 14:33.14 | GD12 | hur |
| 14:33.30 | Wormy_ | quit ur hurr'in |
| 14:34.51 | Wormy_ | the more people pot, the less i test |
| 14:34.53 | GD12 | ruh |
| 14:35.04 | Wormy_ | post lol |
| 14:36.11 | GD12 | i dunz know why im giving myself so much work for my army page |
| 14:36.53 | Wormy_ | hello? |
| 14:37.09 | Wormy_ | ~test irc |
| 14:37.09 | infobot | Testing irc... *****$$#$ |
| 14:37.48 | GD12 | hello |
| 14:37.52 | Wormy_ | cuz u liek uberstomp |
| 14:39.03 | Hachi_ | "The Legionnaire that scoffs at a lasgun has not charged across an open field against a hundred of them." - Maor the Scarred. I found that on the "Death of a Thousand Cuts" page hur |
| 14:39.09 | GD12 | hur |
| 14:39.48 | GD12 | The Kraw Overseers have a lasgun like weapon |
| 14:40.01 | GD12 | well in the fact that it is a laser |
| 14:42.17 | Wormy_ | "wont even dent our navigational deflector" picard |
| 14:42.23 | GD12 | hur |
| 14:42.32 | GD12 | funny how mur-dor doesnt reply to feedback |
| 14:42.49 | Wormy_ | yeah |
| 14:44.05 | Wormy_ | lasers do actually seem oldschool in sporewiki fic |
| 14:44.15 | Wormy_ | lasguns anyway |
| 14:44.54 | OluapWorker | http://24.media.tumblr.com/35a1ed5e76aa461a3ece8fa571b3dc09/tumblr_miswdrCz8B1qdlh1io1_400.gif Xhodocot egg |
| 14:44.56 | OluapWorker | Xhodocto even |
| 14:45.08 | Wormy_ | i suppos given enough energy they become useful again |
| 14:45.14 | GD12 | aye |
| 14:45.50 | Wormy_ | i have a laser pen. i wanttose ones that burst balloons |
| 14:46.37 | GD12 | hur |
| 14:47.02 | Wormy_ | expensive though |
| 14:47.51 | Wormy_ | a friend of a freind who works on a laserfusion reactr project said a laser pen would actually take 2 minutes to blind someone temporarily |
| 14:48.02 | GD12 | hur |
| 14:48.13 | Wormy_ | a low power one on the market anyway |
| 14:48.27 | Wormy_ | ooh my train brb |
| 14:49.16 | GD12 | bai |
| 14:50.33 | Wormy_ | test |
| 14:50.46 | Wormy_ | hi again |
| 14:51.10 | Wormy_ | forever entwined to irc yay |
| 14:51.14 | GD12 | hur |
| 14:51.35 | Wormy_ | indeed |
| 14:51.46 | GD12 | I should update my equipment page soon as well |
| 14:51.50 | GD12 | then again |
| 14:52.00 | GD12 | everyone undesrstands what is meant by laser |
| 14:52.02 | Wormy_ | hey Gd12 ever want to play star trek online? |
| 14:52.28 | Wormy_ | its free 2 ply and lots os play it |
| 14:52.34 | GD12 | hmm |
| 14:52.44 | Wormy_ | we have a starbase and an embassy |
| 14:52.46 | GD12 | i don't think i can as of now. |
| 14:52.59 | GD12 | Perhaps maybe later in the year when i have more free time |
| 14:53.21 | Wormy_ | cool |
| 14:54.37 | Wormy_ | maybe in the easter |
| 14:54.59 | GD12 | perhaps |
| 14:54.59 | Wormy_ | i get a month off and two eeks revision whih is also off |
| 14:55.27 | Wormy_ | Ghelae said he would return for Easter |
| 14:55.56 | GD12 | aye |
| 14:56.08 | GD12 | perfect to get in on AD with his Apalos |
| 14:56.19 | GD12 | One more chapter still AD goes into full swing in the Milky Way |
| 14:57.00 | Wormy_ | hur cephalodins taking ecosytems from Dominatus plants |
| 14:57.06 | Wormy_ | planets |
| 14:57.06 | GD12 | aye |
| 14:57.30 | GD12 | I'm sure cephalodians would be interested in seeing Dominatus engineered animals, specifically epics |
| 14:59.27 | Wormy_ | !they will only be pissed at activist level if they are not living in good conditions like battery farm |
| 14:59.27 | Wormy_ | test |
| 14:59.27 | Wormy_ | so this still covers tunnels |
| 14:59.44 | Wormy_ | bbl now |
| 15:02.04 | GD12 | night |
| 15:02.20 | Hachi_ | dam u oluapfag get bak heer nao |
| 15:17.21 | Jepardi | peep |
| 15:27.18 | OluapWorker | ~kick Hachi_ |
| 15:27.19 | infobot | ACTION kicks Hachi_ |
| 15:47.46 | *** join/#sporewiki R17 (79362259@gateway/web/freenode/ip.121.54.34.89) |
| 16:18.21 | Hachi_ | hur the boss in my game froze |
| 16:18.26 | Hachi_ | So I beat him easily |
| 16:19.09 | OluapWorker | wat game |
| 16:19.25 | Hachi_ | DmC |
| 16:19.28 | Hachi_ | Like first boss |
| 16:19.31 | Hachi_ | He freezes |
| 16:19.42 | OluapWorker | Oh |
| 16:19.47 | Hachi_ | That's lucky for me since I got it on a difficulty |
| 16:19.50 | Hachi_ | That is above hard |
| 16:21.10 | Hachi_ | He just froze in the corner of the arena and wouldn't move |
| 16:21.20 | Hachi_ | So I comboed his head until he died |
| 16:23.03 | OluapWorker | hur |
| 16:23.22 | Hachi_ | Usually he's an easy boss but he gets new moves in every difficulty |
| 16:33.01 | Jepardi | peep |
| 16:36.33 | *** join/#sporewiki OfficerJackal (~thomaspal@69.139.59.13) |
| 16:36.53 | OfficerJackal | Hello! |
| 16:39.01 | *** join/#sporewiki Wormy (d92a9ab0@gateway/web/freenode/ip.217.42.154.176) |
| 16:39.16 | OfficerJackal | Hello. |
| 16:39.20 | Wormy | hi |
| 16:49.23 | *** join/#sporewiki Technobliterator (1f3566f6@gateway/web/freenode/ip.31.53.102.246) |
| 16:49.28 | OfficerJackal | Hello. |
| 16:49.35 | Technobliterator | hii |
| 16:49.38 | Technobliterator | brb |
| 16:49.38 | OluapWorker | dumba |
| 16:57.13 | Technobliterator | OluapWorker: ya dad |
| 16:57.31 | OluapWorker | http://spore.wikia.com/wiki/Planet:Macronormus chek nu paeg |
| 16:57.37 | OluapWorker | Luc made it |
| 16:58.31 | Technobliterator | oooh |
| 16:58.33 | Technobliterator | very nice |
| 16:58.34 | Technobliterator | +1 |
| 16:58.39 | Technobliterator | bbl again:L |
| 16:58.39 | OluapWorker | quote nao |
| 16:58.41 | OluapWorker | dum |
| 16:58.54 | Technobliterator | nu |
| 16:58.58 | Technobliterator | the only thing I can say is "Zr'Ahgloth - wannabe" |
| 17:01.53 | OluapWorker | Then don't say anything |
| 17:02.03 | OluapWorker | if you can't think up of something better |
| 17:09.24 | *** join/#sporewiki Xho (5ac81106@gateway/web/freenode/ip.90.200.17.6) |
| 17:09.43 | *** mode/#sporewiki [+o Xho] by ChanServ |
| 17:09.48 | OfficerJackal | Hello. |
| 17:11.15 | OluapWorker | spu |
| 17:11.29 | Xho | ups |
| 17:11.34 | OluapWorker | http://spore.wikia.com/wiki/Planet:Macronormus chek and quote nao |
| 17:11.41 | OluapWorker | Also http://img841.imageshack.us/img841/392/killmenewell.png |
| 17:12.12 | Xho | Oh god lol |
| 17:13.41 | Technobliterator | yeah, i won't bother with dum quotes |
| 17:15.37 | Xho | coughwhatabitchcough |
| 17:17.00 | OluapWorker | Not really, I was telling her not to do that before you arrived |
| 17:18.09 | Xho | y dat |
| 17:18.40 | OluapWorker | cus LotG worked hard on that page and it would be rude to just go "dum - Loron" on it |
| 17:20.44 | Xho | dere quoted |
| 17:21.04 | OluapWorker | huhu |
| 17:21.18 | OluapWorker | cue Nu getting glomped by army of miniplants |
| 17:21.39 | Xho | Nu - I HATE YOU, I HATE YOU ALL |
| 17:21.49 | OluapWorker | Also this is the female equivalent of the Mikmik http://images3.wikia.nocookie.net/spore/images/a/a9/Red_Vorlora.png |
| 17:22.17 | Xho | Nu - Fuck that is not cute |
| 17:22.58 | Xho | "Faris, which is too cold" |
| 17:23.04 | Xho | Nu - bai i'm going there |
| 17:23.08 | OluapWorker | hur |
| 17:23.26 | OluapWorker | Contrasting with the Mikmiks, Vorloras are Nu-sized |
| 17:23.46 | Xho | Nu - That is not cute at all |
| 17:24.27 | Xho | "Red Mikmik are docile unless attacked first. Approach at will." |
| 17:24.30 | Xho | Nu - LOL FOOTBALL |
| 17:24.55 | OluapWorker | Mikmik - how bout i glomp ur shit |
| 17:25.15 | Xho | Nu - hao u do dat i just kicked u above the clouds loll |
| 17:25.44 | Xho | Nu will probably go nuts from the glomping |
| 17:25.56 | *** join/#sporewiki CyraDroid (~Cyrannian@109.76.223.215) |
| 17:26.01 | OluapWorker | Glomping won't necessarily happen |
| 17:26.06 | OluapWorker | ~punch CyraDroid |
| 17:26.06 | infobot | ACTION lets fly with a wild haymaker which catches CyraDroid right on the nose |
| 17:26.19 | CyraDroid | ~glomp OluapWorker |
| 17:26.19 | infobot | ACTION becomes fully animated as her eyes squint in an upside-down-U formation, gets a running start and tackle-glomps OluapWorker |
| 17:27.01 | OluapWorker | How does Nu's armor react to heat? |
| 17:27.10 | Xho | Very well |
| 17:27.26 | Xho | Nu's armor is designed to survive around 2000 C |
| 17:27.32 | Xho | Although not for long |
| 17:27.43 | Xho | Extensive exposure to that kind of temperature and his armor will fail |
| 17:28.27 | OluapWorker | He might have a hard time when they face the Fogolarth then |
| 17:28.34 | OluapWorker | It's a huge snake living in a lava pool |
| 17:29.06 | Xho | Lava's usually 700 - 1200 C |
| 17:29.17 | OluapWorker | Oh |
| 17:29.20 | OluapWorker | Not that hard then |
| 17:29.21 | *** join/#sporewiki Monet (925a2f0d@gateway/web/freenode/ip.146.90.47.13) |
| 17:29.28 | OluapWorker | Still, lava monster biting you = bad |
| 17:29.28 | Monet | Hi |
| 17:29.29 | OluapWorker | Hey |
| 17:29.42 | OluapWorker | You done that interview yet? |
| 17:30.40 | OluapWorker | dum raptor |
| 17:36.08 | Xho | I wonder if I should do Mahanayan species |
| 17:36.49 | OluapWorker | There's more than one Mahanayan species? |
| 17:36.56 | Xho | My bad |
| 17:36.59 | Xho | Mahanaya species |
| 17:37.04 | OluapWorker | Oh |
| 17:37.05 | OluapWorker | hur |
| 17:38.44 | Xho | http://www.sporistics.com/?p=asset:500840723842 This is the largest creature on Mahanayan |
| 17:38.48 | Xho | Mahanaya even |
| 17:39.41 | Xho | 4.4km long |
| 17:39.47 | OluapWorker | dang |
| 17:39.57 | Xho | That's not even the Alpha one |
| 17:40.10 | OluapWorker | Everything you make has an Alpha version hur |
| 17:40.48 | Xho | The Alpha one is called Mahanzarnthys which means 'World Holder' |
| 17:40.57 | Xho | You can guess how big that is then |
| 17:41.05 | OluapWorker | 1cm |
| 17:41.49 | Xho | aye |
| 17:41.50 | Xho | dum |
| 17:42.01 | OluapWorker | What's stooping something that big from destroying cities and stuff like that |
| 17:42.03 | Xho | I'd imagine it's around 50-60km long |
| 17:42.04 | OluapWorker | stopping even |
| 17:42.06 | Xho | It's dormant |
| 17:42.25 | Xho | And the Ahanathelymo are afraid of Mahanayans nowadays |
| 17:42.38 | Xho | Mahanayans have the tech to kill them quickly |
| 17:42.40 | *** join/#sporewiki Hachi_ (5198bef1@gateway/web/freenode/ip.81.152.190.241) |
| 17:42.40 | Hachi_ | Hai guys |
| 17:42.49 | OluapWorker | Mahanayan - lol bugs go splat |
| 17:42.51 | *** join/#sporewiki TheBuilder (ba30146b@gateway/web/qwebirc/irc.wikia.com/ip.186.48.20.107) |
| 17:42.52 | Xho | Mahanayans are still like "OH SHIT" when they see one though |
| 17:42.54 | OluapWorker | Return of the dum buni |
| 17:43.00 | Hachi_ | Mayahans do what now |
| 17:43.15 | Xho | The Ahanathelymo beast which is a 4.4km long scorpion |
| 17:43.19 | OluapWorker | Xho has creatures that make Brakur Colossi look tiny |
| 17:43.21 | TheBuilder | Hello |
| 17:43.21 | OluapWorker | Nothing new really |
| 17:43.24 | TheBuilder | Hello |
| 17:43.24 | *** join/#sporewiki OfficerJackal (~thomaspal@69.139.59.13) |
| 17:43.25 | Xho | Basically Mahanayans nowadays can kill them easily |
| 17:43.39 | OluapWorker | Brukar |
| 17:43.47 | OluapWorker | I keep confusing Brukar with Brakur |
| 17:43.49 | Xho | Most of Mahanaya's beasts range between 12 - 40m in size |
| 17:44.30 | Monet | That ant bug's oxygen intake must be ridiculous. |
| 17:44.33 | OluapWorker | dum |
| 17:44.43 | OluapWorker | Only thing that big in Macronormus is the Imperator Routrix |
| 17:45.20 | Xho | The Mahanzarnthys has never been seen fully but some claim to have seen its tail completely shred landscapes |
| 17:45.51 | OluapWorker | Group's plan to kill Imperator = throw Nu at it |
| 17:45.57 | Xho | Nu - fuck |
| 17:46.19 | Hachi_ | ohgod |
| 17:46.33 | OluapWorker | Monet: Check this out http://spore.wikia.com/wiki/Planet:Macronormus |
| 17:46.38 | OluapWorker | Hachi made that page |
| 17:46.43 | Hachi_ | :3 |
| 17:48.35 | OluapWorker | http://spore.wikia.com/wiki/Planet:Macronormus/Species and these are the things Sarec will have to deal with |
| 17:48.41 | Xho | There have been bigger creatures than the Mahanzarnthys however |
| 17:49.32 | Xho | In the deepest reaches of Mahanaya's canyons one can see bones that go across for hundreds of kilometres |
| 17:50.10 | Xho | Mahanaya is not a vacation spot at all |
| 17:50.28 | Xho | I'd pick Macronormus over Mahanaya |
| 17:50.37 | Xho | Even though the chances of death don't differ at all |
| 17:50.45 | OluapWorker | It's like you're saying these things to try to demoralize me |
| 17:50.51 | Xho | My bad |
| 17:50.52 | Wormy | Really? You could make a tourist indistry for people to ride inspide the hyper-epic's skin pores |
| 17:50.57 | Xho | I like demoralizing people |
| 17:51.39 | Xho | Question however |
| 17:51.42 | OluapWorker | Macronormus is not that much of a deathtrap as long as you keep away from the larger carnivores |
| 17:51.50 | Xho | How come the Brukar Colossus' size is indeterminate |
| 17:51.53 | OluapWorker | And if you get to kill one, it's food for at least a weak |
| 17:51.54 | OluapWorker | week even |
| 17:52.12 | OluapWorker | Because they have not been studied properly yet |
| 17:52.20 | Xho | Nu - i gon study dis bitch |
| 17:53.15 | OluapWorker | It's bigger than the Imperator Routrix, that's for sure |
| 17:53.18 | Xho | Actually i'd pick Macronormus over Mahanaya |
| 17:53.20 | Xho | Natives are nice |
| 17:53.50 | Xho | Mikmik come and glomp you |
| 17:53.52 | OluapWorker | http://images2.wikia.nocookie.net/__cb20130302215655/spore/images/7/74/Perterrent.png Yes, yes they are |
| 17:53.55 | Xho | Mahanayans come and glomp you |
| 17:54.10 | Xho | Two totally different kinds of glomp |
| 17:54.41 | OluapWorker | Mahanayans and more tender and sweet and are much more fluffy |
| 17:55.08 | Xho | o rly |
| 17:55.09 | Wormy | Mahanayans have yet to see the benefits of tourism, thats all. |
| 17:55.39 | Xho | Mahanayan - come to Mahanaya, average temperature 50 degrees, no water and every single species is carnivorous! |
| 17:55.46 | Xho | Not a good brochure I tell you |
| 17:55.53 | Wormy | lol |
| 17:55.59 | OluapWorker | Mikmik - challengeaccepted.png |
| 17:56.14 | Wormy | Some mad people would do it |
| 17:56.26 | Xho | I wonder what's worse |
| 17:56.28 | OluapWorker | Actually no, they need water to survive |
| 17:56.31 | Xho | Mahanaya or Afiloxenos |
| 17:56.33 | *** join/#sporewiki EmperorsWrath (~yaaic@host-164-156-66-217.spbmts.ru) |
| 17:56.37 | OluapWorker | New Draka |
| 17:56.38 | OluapWorker | hur |
| 17:56.40 | OluapWorker | hi |
| 17:56.40 | EmperorsWrath | Hi |
| 17:56.47 | Xho | Afiloxenos is probably worse actually |
| 17:56.51 | Wormy | hi |
| 17:56.55 | EmperorsWrath | http://spore.wikia.com/wiki/Creature:Rades Noo paeg |
| 17:57.00 | Xho | Actually no |
| 17:57.04 | Xho | Mahanaya is worse |
| 17:57.15 | OluapWorker | Afiloxenos sounds like the place where the natives are worse than the wildlife |
| 17:57.23 | Xho | Afiloxenos doesn't actually have wildlife because the natives extincted them all |
| 17:57.37 | Hachi_ | c |
| 17:57.41 | Hachi_ | C |
| 17:57.47 | EmperorsWrath | Read the page dammit |
| 17:58.01 | OluapWorker | I read it already, shup your face |
| 17:58.02 | Xho | Mikmik - hey dis not hapi planet |
| 17:58.12 | OluapWorker | http://spore.wikia.com/wiki/Planet:Macronormus you read noo paeg |
| 17:58.31 | Xho | My planets have a recurring theme |
| 17:58.45 | OluapWorker | Biologically impossible |
| 17:58.49 | OluapWorker | hur |
| 17:58.52 | Xho | Often they're barren, deserted and often filled to the brim with ginormous omnicidal carnivores |
| 17:59.11 | Xho | Paclernos is the only exception |
| 17:59.24 | Xho | Paclernos is for the most part normal |
| 18:00.03 | OluapWorker | dum if Jo was here we could rp |
| 18:00.10 | OluapWorker | Need to finish that goddamned war already |
| 18:00.20 | Xho | Although I dunno what the tallest peak on Afiloxenos is |
| 18:00.40 | Xho | Mahanaya's tallest peak is just over 100,000ft in height |
| 18:01.02 | Xho | Mikmiks go climb that |
| 18:01.07 | Xho | Mahanayans are very surprised they lived |
| 18:01.22 | OluapWorker | hur |
| 18:01.24 | Xho | Mahanayans - bitch what are these guys made of |
| 18:01.34 | OluapWorker | Mikmik - sugar and hugs |
| 18:01.45 | Xho | 100,000ft is around 31,000 m |
| 18:01.53 | Xho | Mahanayans - hao u hug mountain |
| 18:02.02 | OluapWorker | Mikmik - with big arms |
| 18:02.06 | Hachi_ | ohgod |
| 18:02.10 | Xho | Mahanayans - go bak to smokin weed u |
| 18:02.12 | OluapWorker | Red Mikmiks wouldn't mind the temperature but they would mind the lack of water |
| 18:02.24 | OluapWorker | They can sustain much higher temperatures than 50º |
| 18:02.37 | Hachi_ | Purple Mikmik - ur 1 cheeky cunt m8 |
| 18:02.40 | Xho | Mahanayan water is very uncommon above ground |
| 18:02.52 | Xho | Water on the surface is IMMENSELY saline |
| 18:03.25 | Xho | Water below ground is often clean |
| 18:03.35 | Xho | Mikmiks would like underground Mahanaya |
| 18:03.44 | OluapWorker | They spend the night underground |
| 18:03.45 | Hachi_ | No sunlight |
| 18:03.50 | Xho | Bar the thousands of species that live underground |
| 18:04.15 | OluapWorker | Night at Macronormus' surface = all the big carnivores are awake |
| 18:04.27 | Xho | Main problem going underground is that meeting an Ahanathelymo is a thousand times greater |
| 18:05.21 | OluapWorker | They'll have to take turns to sleep |
| 18:05.25 | OluapWorker | Otherwise nom |
| 18:05.36 | Hachi_ | Hachi stays awake all nights |
| 18:05.49 | Xho | Nu doesn't have to sleep hur |
| 18:05.58 | OluapWorker | gud, Nu is the guard then |
| 18:06.00 | Xho | Nu - y |
| 18:06.16 | OluapWorker | Baptarion - cus if u dunt, dat big mouth lizard will eet u |
| 18:08.01 | EmperorsWrath | casts Enchant on everyone and forces them to read the page |
| 18:08.17 | OluapWorker | I said I read it already |
| 18:10.57 | EmperorsWrath | Ah |
| 18:15.24 | EmperorsWrath | Want to leave a quote? |
| 18:15.29 | EmperorsWrath | What about you, Mone |
| 18:15.33 | EmperorsWrath | Monet |
| 18:16.39 | EmperorsWrath | Oh wair left |
| 18:23.57 | Hachi_ | Xho: I bet you cant do this song on your guitar https://www.youtube.com/watch?v=mI-JcVBBjHI |
| 18:25.45 | Xho | “And so, the Demiurges saw the universal lie. The universal truth is, that the only truth is us.” - Ayrai'Shikua |
| 18:26.17 | Hachi_ | troll |
| 18:26.34 | EmperorsWrath | Rades - We shall understand the shit out of you |
| 18:26.46 | Xho | Ayrai'Shikua - lol good luck |
| 18:26.47 | OluapWorker | olol |
| 18:29.54 | Jepardi | peep |
| 18:31.20 | Xho | Jepardi: I like your Quetzalcoatl |
| 18:31.29 | Jepardi | Thanks |
| 18:31.53 | Xho | http://images.wikia.com/spore/images/3/3b/AnathemusOfXenomortisPortrait.png FUCK WHAT |
| 18:32.24 | OluapWorker | That's a week or two old already |
| 18:32.37 | Xho | Really now |
| 18:32.43 | Xho | Well sorry for being dum |
| 18:33.31 | OluapWorker | You're forgiven hur |
| 18:35.54 | *** join/#sporewiki Zmr56 (522fb4b4@gateway/web/freenode/ip.82.47.180.180) |
| 18:35.56 | Zmr56 | Hello people |
| 18:36.20 | OfficerJackal | Hello. |
| 18:41.09 | EmperorsWrath | Will you leave a quote Ow? |
| 18:42.38 | OluapWorker | ok |
| 18:43.38 | OluapWorker | there, quoted |
| 18:43.46 | OluapWorker | Now you check this page http://spore.wikia.com/wiki/Planet:Macronormus |
| 18:49.40 | *** join/#sporewiki Wormy (d92a9ab0@gateway/web/freenode/ip.217.42.154.176) |
| 18:49.50 | Wormy | That hurt |
| 18:50.37 | OluapWorker | Weird |
| 18:50.45 | OluapWorker | It said you left because of Excess Flood |
| 18:51.06 | Wormy | I spammed #sporecreate by hitting the enter bar rapidly |
| 18:51.23 | Xho | y u do dis |
| 18:51.45 | Wormy | for teh lulz |
| 18:55.46 | *** part/#sporewiki Aeo (3253b7b1@gateway/web/freenode/ip.50.83.183.177) |
| 19:09.51 | *** join/#sporewiki Zmr56 (522fb4b4@gateway/web/freenode/ip.82.47.180.180) |
| 19:09.56 | Zmr56 | IRC just jelly of my no rulez zone |
| 19:12.49 | Zmr56 | Anyway...I wihs to join Demun event thingy Mortem or whatever |
| 19:18.04 | Zmr56 | *wish |
| 19:18.43 | Hachi_ | http://sphotos-d.ak.fbcdn.net/hphotos-ak-prn1/540903_543090689064835_828935622_n.jpg |
| 19:19.15 | OluapWorker | huh |
| 19:19.22 | EmperorsWrath | Hitler ate sugar! |
| 19:20.38 | Hachi_ | http://sphotos-a.ak.fbcdn.net/hphotos-ak-snc7/394590_537565259617634_1885502857_n.jpg |
| 19:20.48 | OluapWorker | hur |
| 19:21.31 | EmperorsWrath | Ngh where are Monet and Cyrannian |
| 19:21.42 | EmperorsWrath | I want them to see my page |
| 19:22.26 | Hachi_ | http://sphotos-h.ak.fbcdn.net/hphotos-ak-prn1/155966_508337629214146_1205187927_n.jpg |
| 19:23.21 | Xho | lul |
| 19:23.32 | OluapWorker | dem birds |
| 19:24.23 | Wormy | The Birds are singing! It is beautiful! |
| 19:25.04 | Wormy | http://www.youtube.com/watch?v=0c1pLN6AcoU |
| 19:28.20 | OluapWorker | ~punch Xho |
| 19:28.21 | infobot | ACTION lets fly with a wild haymaker which catches Xho right on the nose |
| 19:28.24 | OluapWorker | go code up rp nao |
| 19:28.54 | Xho | i doin homework shup |
| 19:29.20 | Hachi_ | fuk ur hoemwork |
| 19:29.29 | Hachi_ | homework* |
| 19:29.35 | OluapWorker | homowork |
| 19:29.36 | EmperorsWrath | Wormy: Seen my Rades page? |
| 19:29.57 | Hachi_ | ohgod |
| 19:29.59 | Hachi_ | homowkr |
| 19:30.02 | Hachi_ | homowrk* |
| 19:30.04 | Hachi_ | FUK |
| 19:30.10 | Hachi_ | homowork* |
| 19:30.15 | EmperorsWrath | If you have time we can work on their tech etc |
| 19:32.25 | Wormy | Okay then |
| 19:32.35 | Wormy | I've seen some of it |
| 19:32.40 | Wormy | Looks interesting |
| 19:38.46 | *** join/#sporewiki Monet (925a2f0d@gateway/web/freenode/ip.146.90.47.13) |
| 19:38.51 | Zmr56 | Hi |
| 19:39.01 | Monet | hi |
| 19:39.59 | Hachi_ | Monet |
| 19:40.02 | Hachi_ | Do your homowork |
| 19:40.02 | EmperorsWrath | Hi Monet |
| 19:40.06 | EmperorsWrath | @ http://spore.wikia.com/wiki/Creature:Rades |
| 19:40.20 | Monet | But homework's bo-ring! |
| 19:40.28 | Hachi_ | HOMOWORK |
| 19:40.29 | Hachi_ | NOW |
| 19:40.56 | Monet | But daaaad! |
| 19:41.55 | EmperorsWrath | HOMOWORK |
| 19:42.45 | Xho | Homowork |
| 19:42.52 | Xho | dis is scary |
| 19:42.59 | Xho | dos os scory |
| 19:44.15 | Zmr56 | this... |
| 19:44.28 | Zmr56 | this... |
| 19:44.28 | Zmr56 | thos... |
| 19:44.28 | Hachi_ | thos... |
| 19:44.40 | Zmr56 | os onfoctong mo |
| 19:44.50 | Zmr56 | (is infecting me) |
| 19:45.25 | Zmr56 | Oarth |
| 19:49.50 | EmperorsWrath | *Oorth |
| 19:51.02 | *** join/#sporewiki Aeon (63778f3e@gateway/web/qwebirc/irc.wikia.com/ip.99.119.143.62) |
| 19:51.36 | *** join/#sporewiki Cyrannian (6d4cdfd7@gateway/web/freenode/ip.109.76.223.215) |
| 19:51.36 | *** mode/#sporewiki [+o Cyrannian] by ChanServ |
| 19:51.43 | OfficerJackal | Hello! |
| 19:51.52 | EmperorsWrath | Hi |
| 19:51.53 | Cyrannian | Hi |
| 19:51.57 | OluapWorker | ~tackle Cyrannian |
| 19:51.57 | infobot | ACTION tackles Cyrannian to the ground. |
| 19:51.58 | Cyrannian | ~bitchslap OluapWorker |
| 19:51.58 | infobot | ACTION beats the sh*t out of OluapWorker |
| 19:52.13 | EmperorsWrath | Cyrannian and Monet: http://spore.wikia.com/wiki/Creature:Rades Noo page |
| 19:53.49 | EmperorsWrath | Or rather |
| 19:53.51 | EmperorsWrath | http://www.dota2wiki.com/images/9/9a/Warl_respawn_05.mp3 |
| 19:55.09 | Cyrannian | Nice work |
| 19:55.35 | EmperorsWrath | Thanks |
| 19:56.14 | Xho | Okay done my homework |
| 19:56.21 | Xho | 1,208 word essay in 33 minutes |
| 19:56.24 | Xho | u jelly |
| 19:56.31 | EmperorsWrath | is jelly |
| 19:56.37 | *** join/#sporewiki Jepardi (d5f38d50@gateway/web/freenode/ip.213.243.141.80) |
| 19:56.40 | Jepardi | Hi |
| 19:56.43 | EmperorsWrath | HI |
| 19:57.13 | Monet | EmperorsWrath: Quoted. |
| 19:57.58 | EmperorsWrath | Nice |
| 19:58.10 | Aeon | Should i be bothering to try to help Murr-dorr. understand how this place works? |
| 19:58.31 | Xho | Probably not |
| 19:58.37 | Xho | Depending on how conforming he is |
| 19:59.04 | Aeon | I think the problem is that our statements are not penetrating him. |
| 20:00.16 | Hachi_ | "penetrating" |
| 20:00.19 | Hachi_ | I lol'd |
| 20:00.25 | Aeon | you know what I mena\ |
| 20:00.29 | Aeon | *mean. |
| 20:00.56 | Cyrannian | I lol'd because I knew Hachi_ would lol |
| 20:01.20 | Zmr56 | Sheesh |
| 20:01.35 | Zmr56 | Guy should just make his own wiki |
| 20:01.57 | Aeon | I was about to say he wouldn |
| 20:02.08 | Aeon | nvm |
| 20:02.30 | Aeon | I think he'd object that he didn't get any collaborators. |
| 20:02.33 | Aeon | *wouldn't |
| 20:03.17 | OluapWorker | ngh y people dun quote my page |
| 20:03.21 | OluapWorker | or rather, Luc's page |
| 20:03.23 | OluapWorker | our page |
| 20:04.36 | EmperorsWrath | Which one |
| 20:04.45 | Xho | i quoted u |
| 20:04.46 | Xho | LOVE ME |
| 20:04.59 | OluapWorker | http://spore.wikia.com/wiki/Planet:Macronormus |
| 20:05.08 | OluapWorker | This is the third time i'm giving you a link to it |
| 20:05.10 | OluapWorker | ~love Xho |
| 20:05.10 | infobot | If you love Xho so much, why don't you marry it? (oooooh) |
| 20:05.20 | OluapWorker | dun challenge me |
| 20:06.34 | EmperorsWrath | Xho |
| 20:06.39 | EmperorsWrath | It |
| 20:06.42 | EmperorsWrath | Lul |
| 20:06.46 | EmperorsWrath | OluapWorker: Quoted |
| 20:07.19 | OluapWorker | "It" is a good way of describing Xho |
| 20:07.24 | Xho | Aye |
| 20:07.26 | Xho | Wait what |
| 20:07.44 | OluapWorker | Venoriel doesn't like anything |
| 20:09.16 | OluapWorker | Also just as information, the final battle of the BoreWar has its own page now http://spore.wikia.com/wiki/Fiction:Second_Borealis_Galactic_War/Wrath_of_Gods/Changing_History/Final_Battle |
| 20:09.23 | OluapWorker | It's getting too big |
| 20:11.32 | Wormy | <PROTECTED> |
| 20:11.39 | Cyrannian | How many people do you need for the next section? |
| 20:12.16 | OluapWorker | You mean the Borealis War or the Xhodocto war? |
| 20:12.25 | Cyrannian | The Borealis War. |
| 20:12.45 | OluapWorker | Well there's 2 groups |
| 20:12.55 | OluapWorker | Either me, Jo, Xho, Imp and Hachi |
| 20:12.57 | OluapWorker | or me, Jo and Monet |
| 20:13.43 | OluapWorker | But a certain dumba is missing |
| 20:14.57 | EmperorsWrath | OluapWorker and Hachi_: I have an idea of who could I send to Macronomus |
| 20:15.01 | EmperorsWrath | A Stalkie. |
| 20:16.31 | OluapWorker | How big are Stalkies again? |
| 20:17.15 | EmperorsWrath | 10m |
| 20:17.24 | Xho | Meta-Skhánaróton |
| 20:17.35 | Xho | Because the planet needs some gardening |
| 20:17.36 | OluapWorker | Well |
| 20:17.45 | OluapWorker | That would kinda defeat the point of the fiction |
| 20:17.54 | OluapWorker | It's supposed to be tiny group vs giant monsters |
| 20:18.20 | EmperorsWrath | Stalkie - Yay feels like home again |
| 20:18.56 | OluapWorker | The Brukars would think the Stalkie is their mommy |
| 20:20.36 | Jepardi | peep |
| 20:23.19 | Aeon | http://spore.wikia.com/wiki/User_blog:Mur-dorr./major_war_story_idea. Is my comment here good? I don't want to come off as too forceful. |
| 20:23.36 | Aeon | and the period is part of the link. |
| 20:25.19 | OluapWorker | Your comment is good, yes |
| 20:26.05 | Monet | Who puts full stops in a title? |
| 20:26.22 | OluapWorker | This guy does |
| 20:26.24 | OluapWorker | :v |
| 20:28.07 | Cyrannian | Oh Monet, how did your interviews go? |
| 20:29.01 | Monet | I think it went well They did like my work. But I slipped up: I confessed I didn't know much about the college itself. |
| 20:29.21 | OluapWorker | dum I asked you hous ago and you ignored me |
| 20:29.42 | Monet | Sorry, my dad convinced me to call my mum about it and she wouldn't stop talking. |
| 20:29.50 | OluapWorker | hur |
| 20:29.54 | OluapWorker | http://img.sadistic.pl/pics/316fc5b68075.gif Oluap vs Cyrannian |
| 20:30.58 | Hachi_ | Soz was having dinner |
| 20:31.01 | Hachi_ | Why was I beeped |
| 20:31.22 | OluapWorker | Because you'll dai |
| 20:31.37 | Monet | I sent you a PM but I was probably rambling. |
| 20:32.23 | Cyrannian | OluapWorker: hur |
| 20:32.24 | EmperorsWrath | I suggested having a Stalkie (a hugeass Divinarium spider species) as a part of the Macrostuff expedition |
| 20:32.38 | Hachi_ | Nah |
| 20:32.43 | Hachi_ | That defeats the point |
| 20:33.25 | OluapWorker | "You must be this short to enter the planet" |
| 20:33.30 | Zmr56 | claps for Aeon |
| 20:33.54 | Aeon | Zmr56: For that post? |
| 20:34.00 | OluapWorker | If you want a character in, he'll have to be 4 meters tall or less |
| 20:34.03 | Zmr56 | yep |
| 20:34.07 | OluapWorker | he, she, it |
| 20:34.38 | Hachi_ | And how short? |
| 20:34.59 | OluapWorker | There's no minimal size, only max |
| 20:35.21 | EmperorsWrath | Rades - Yay |
| 20:35.32 | Monet | So no Ark. |
| 20:35.40 | OluapWorker | Nope |
| 20:35.50 | OluapWorker | My char's gonna be Baptarion |
| 20:35.56 | Aeon | Zmr56: Well I want to help him. I like having more users in. |
| 20:36.16 | Zmr56 | Me too |
| 20:36.17 | OluapWorker | Time to put those archeologist skills to use |
| 20:37.15 | Aeon | I don't think he's actually read the guidelines yet. |
| 20:37.29 | *** join/#sporewiki Hachi___ (5198bef1@gateway/web/freenode/ip.81.152.190.241) |
| 20:37.35 | Hachi___ | Fuck. |
| 20:37.38 | OluapWorker | u |
| 20:37.45 | Hachi___ | No. |
| 20:37.48 | Hachi___ | Your mom |
| 20:37.53 | OluapWorker | :c |
| 20:38.14 | *** join/#sporewiki Cyrannian_ (6d4cdfd7@gateway/web/freenode/ip.109.76.223.215) |
| 20:38.14 | *** mode/#sporewiki [+o Cyrannian_] by ChanServ |
| 20:38.26 | Cyrannian_ | My compooper kerploded. |
| 20:38.27 | Hachi___ | I hope you get pins and needles. |
| 20:38.37 | Cyrannian_ | ~seen Cyrannian |
| 20:38.45 | infobot | cyrannian is currently on #sporewiki (47m 9s) #cyrannus (47m 9s). Has said a total of 8 messages. Is idling for 6m 22s, last said: 'OluapWorker: hur'. |
| 20:38.50 | EmperorsWrath | Hachi___: Secretly, Oluap is your brother. |
| 20:39.04 | Hachi___ | That would be awesome |
| 20:39.11 | OluapWorker | *abominable |
| 20:39.31 | OluapWorker | That would make me an unholy rabbit-human hybrid |
| 20:39.35 | EmperorsWrath | So you share a mom. |
| 20:39.36 | Wormy | sent a comment |
| 20:39.44 | EmperorsWrath | :3 |
| 20:39.55 | Cyrannian | As I was saying, could I join with this fellow: http://spore.wikia.com/wiki/Captain%3ARiordan_Rambertan |
| 20:40.15 | OluapWorker | You want to join the planet exploration? |
| 20:41.06 | OfficerJackal | Ping-pocalypse. |
| 20:41.11 | Cyrannian | aye |
| 20:41.16 | Hachi_ | FUCK YO SHIT |
| 20:41.43 | OluapWorker | Incredilicious |
| 20:41.50 | OluapWorker | Didn't expect you to be interested |
| 20:42.05 | Cyrannian | I have been looking for a way to get my explorer guy involved in something |
| 20:42.47 | OluapWorker | You shall be forced to take part of roleplays |
| 20:42.55 | OluapWorker | *laugh with thunder in the background* |
| 20:43.07 | Cyrannian | :O |
| 20:43.12 | Hachi_ | Everytime a man touches your nipples, Jesus sets a school bus on fire. |
| 20:43.22 | OluapWorker | But yeah, count Riordan in |
| 20:43.24 | Cyrannian | dafuq |
| 20:43.28 | OluapWorker | What what |
| 20:43.38 | OluapWorker | What twice for extra what |
| 20:44.41 | OluapWorker | So we got an ascended Draconis, a rabbit, an omnicidal super soldier, a not-omnicidal super soldier, a Radeon scientist and a Rambo adventurer |
| 20:44.43 | OluapWorker | Quite a group |
| 20:44.55 | Xho | Nu - i'm the rabbit |
| 20:45.22 | OluapWorker | aye |
| 20:45.23 | Xho | Also |
| 20:45.26 | Xho | OluapWorker: http://cloud-2.steampowered.com/ugc/882975577025965826/7639EEE4F0190F3D4D58E59743ED2F7302F6CE84/ |
| 20:45.54 | OluapWorker | Xho: MSG is a goner |
| 20:46.00 | Hachi_ | NiiN - FISHING TIME |
| 20:46.02 | Xho | They're both goners hur |
| 20:46.09 | Hachi_ | boners* |
| 20:46.16 | Cyrannian | The planet should have a massive Dvottie subspecies that vomits rivers of fabulousity |
| 20:46.43 | OluapWorker | We already got the cute critter slot filled |
| 20:46.58 | OluapWorker | http://spore.wikia.com/wiki/Planet:Macronormus/Species#Mikmik_Family by these guys |
| 20:47.01 | Monet | Are giant dvotties still cute though? |
| 20:47.38 | Cyrannian | Yes. Yes, they are. |
| 20:47.44 | OluapWorker | First thing you do when you spot a Migehew is throw Hachi at it |
| 20:47.51 | Hachi_ | NO. |
| 20:47.54 | OluapWorker | YES |
| 20:48.05 | *** join/#sporewiki Zmr56 (522fb4b4@gateway/web/freenode/ip.82.47.180.180) |
| 20:48.55 | Hachi_ | Those things are terrifying |
| 20:49.16 | OluapWorker | Throw at Migeharverus instead then |
| 20:49.36 | Wormy | The Cephalodians do not approve of the scientists on Macronormus that kill threat level 5 animals. |
| 20:50.01 | EmperorsWrath | Venoriel - Nobody listens to you hippies hur |
| 20:50.09 | Xho | http://xho3546.deviantart.com/art/Do-Not-Look-Up-357703936 dere |
| 20:50.14 | OluapWorker | It's not a "hunt to extinction" thing |
| 20:50.28 | OluapWorker | It's "if scientists are attacked, kill it before it kills everyone" |
| 20:50.49 | Cyrannian | http://spore.wikia.com/wiki/Fiction:Galactic_Empire_of_Cyrannus/Imperial_Senate - ermagerd perlatics |
| 20:50.51 | Wormy | A Cephalodian would allow itself to be eaten |
| 20:51.00 | OluapWorker | Cephalodian - I WILL BE ONE WITH YOU |
| 20:51.13 | Wormy | lol |
| 20:51.38 | OluapWorker | Things marked as Level 5 are usually dangerous on a city-levelling scale |
| 20:52.29 | Monet | Cyrannian: That reminds me, you still have that story to write. |
| 20:53.11 | OluapWorker | The Migeharverus is (arguably) small but it is a literal walking wasteland who constantly shifts between solid and gaseous |
| 20:53.20 | Xho | Nu - Well shit |
| 20:53.33 | Cyrannian | I was thinking about simply sending the Draconis a transmission from the Empire suggesting a cleanslate to their relations |
| 20:53.46 | OluapWorker | And the Perterrent is supposed to be Eldritch Abomination-y |
| 20:54.19 | OluapWorker | Anteddy - fuq u draconis huhuhu |
| 20:54.43 | Cyrannian | Though then again, I haven't decided yet |
| 20:55.00 | OluapWorker | http://images1.wikia.nocookie.net/__cb20130303002344/spore/images/b/b7/Migeharverus.png I have to say I'm proud of the eyes. This thing is technically a malformed fetus |
| 20:55.25 | Cyrannian | He looks sexual |
| 20:55.32 | OluapWorker | You look sexual |
| 20:55.32 | OluapWorker | wait |
| 20:55.56 | Cyrannian | Gee thanks |
| 20:55.58 | Monet | Well... How effective was Marshal Karamus' speech when it was heard by the rest of the empire? |
| 20:56.43 | Cyrannian | Pretty successful |
| 20:56.50 | OluapWorker | http://25.media.tumblr.com/5cf2e2f4d4ef79e46ff180b1460e48d1/tumblr_mhm0bzr2BD1qj43juo1_500.png |
| 20:57.19 | Xho | https://fbcdn-sphotos-g-a.akamaihd.net/hphotos-ak-ash3/549831_599639646731546_1825708924_n.jpg troll |
| 20:57.42 | OluapWorker | And then slap |
| 20:58.06 | Wormy | I've seen those comics on cards |
| 20:58.20 | Wormy | birthday ones for old people |
| 20:59.17 | OluapWorker | http://puu.sh/2c7PS Prepare for nightmares |
| 20:59.51 | Monet | Cyrannian: Up to you I suppose. Thanks to the way Antediluvian has things, is a plea to the Senate really going to do anything? |
| 21:00.18 | Xho | OluapWorker: Can't stop laughing |
| 21:00.30 | Cyrannian | Good point. I'll just send a transmission |
| 21:00.44 | OluapWorker | Anteddy - hohohoh look at them people with their "opinions" |
| 21:00.47 | EmperorsWrath | Monet: https://www.youtube.com/watch?v=PTuf-dq1Umw&feature=youtube_gdata_player |
| 21:02.45 | Wormy | cries |
| 21:02.58 | Wormy | Make mlp stop, please... |
| 21:03.19 | Wormy | Its driving me insaaane, but no-one listens on the internet, for it is too late |
| 21:03.20 | OluapWorker | That made me laugh way too much |
| 21:03.26 | Monet | CLEANSE YOUR PALLETE http://www.youtube.com/watch?v=FFgNbZbYChY&NR=1&feature=endscreen&list=FLSDaPfEkllilSniJzgrMziA |
| 21:03.42 | EmperorsWrath | Wormy: Nevah |
| 21:03.56 | Aeon | ^ |
| 21:03.58 | EmperorsWrath | tortures Wormy with Pony Lightning |
| 21:04.12 | Aeon | does the same with pony ice |
| 21:04.39 | Wormy | Gets sent to a mental assylum |
| 21:06.01 | EmperorsWrath | If you will not be ponified, you will be destroyed! Young fool. Only now at the end do you understand. Your feeble skills are no match for the power of the pony side. You have paid the price for your lack of friendship. Now, young Wormwalker, you will die." |
| 21:06.23 | EmperorsWrath | throws Pony Lightning at Wormy |
| 21:06.38 | Hachi_ | http://www.derper.com/images/50360e001d41c8769e00003e.jpg?mw=555 |
| 21:06.56 | Wormy | Is put out of his misery |
| 21:07.00 | Wormy | THANK YOU |
| 21:07.44 | EmperorsWrath | Why didn't anyone throw me into a Friendship Star II? |
| 21:09.01 | Monet | I am reminded of Star Trek II. |
| 21:09.17 | Monet | PPPPPPOOOOOOOOOONNNNN(yyy) |
| 21:09.18 | Wormy | I go on youtube... Advert states "Behold the plucky little wonder pony" |
| 21:09.23 | EmperorsWrath | That is from Return of the Jedi |
| 21:09.29 | EmperorsWrath | Wormy: Oh gawd |
| 21:09.47 | EmperorsWrath | Well you would hate to live in my family hur |
| 21:10.00 | EmperorsWrath | I have a little sister so ponies follow me IRL too |
| 21:10.16 | EmperorsWrath | Granted she likes Tom and Jerry more |
| 21:10.35 | OluapWorker | Stupid adult males with ye stupid animated horses |
| 21:10.53 | Wormy | http://www.youtube.com/watch?v=Ekr05T9Iaio&feature=player_adunit |
| 21:11.12 | Hachi_ | PONIES OluapWorker |
| 21:11.24 | OluapWorker | calls the police |
| 21:11.35 | Wormy | <PROTECTED> |
| 21:11.47 | EmperorsWrath | OluapWorker: And ye Xenomorph Succubi Tyranid Undines too |
| 21:12.02 | EmperorsWrath | *Dementor Succubi |
| 21:13.48 | EmperorsWrath | https://www.youtube.com/watch?v=rVToqPodX1Q&feature=youtube_gdata_player |
| 21:13.52 | EmperorsWrath | Wormy |
| 21:13.58 | EmperorsWrath | Look at my comments |
| 21:14.10 | EmperorsWrath | And Gabriel's |
| 21:15.10 | Wormy | owned |
| 21:15.13 | Cyrannian | What do people think about Guolivian? |
| 21:15.20 | Xho | Kithworto - quiet and dum |
| 21:15.26 | Wormy | hur |
| 21:16.01 | OluapWorker | Koluap - Imperial = dum |
| 21:16.08 | EmperorsWrath | He's an interesting character IMO |
| 21:16.18 | Cyrannian | No, not in universe |
| 21:16.24 | OluapWorker | oh |
| 21:16.26 | OluapWorker | I like him |
| 21:17.51 | Monet | He is likeable. But manybe it helps that until recently it was him, Mar-Juun and Tyranus as the only named Basileus. And he is the most friendly. |
| 21:18.15 | Xho | I've changed my Steam profile picture |
| 21:18.52 | Wormy | My god, this guy is blue http://www.youtube.com/watch?v=VcwanHa0Tqw |
| 21:19.05 | Hachi_ | http://images1.wikia.nocookie.net/__cb1359364349/common/avatars/thumb/6/60/2033187.png/150px-2033187.png This has been my wiki avatar for a while |
| 21:19.21 | OluapWorker | That reminds me of Earthworm Jim |
| 21:19.22 | OluapWorker | Now ded |
| 21:19.35 | Monet | Dat House. |
| 21:23.37 | Wormy | man eats doederant http://www.youtube.com/watch?v=MaEJ9WXlCuE |
| 21:23.42 | Wormy | deo |
| 21:23.43 | Monet | What are your opinions on Hugh Lawrie. |
| 21:27.40 | Monet | What... my computer arbitrarily opened a tab for PlanetSide 2. |
| 21:29.04 | Hachi_ | http://sphotos-c.ak.fbcdn.net/hphotos-ak-ash3/577814_420677368024958_1160025746_n.jpg |
| 21:30.32 | Hachi_ | http://sphotos-a.ak.fbcdn.net/hphotos-ak-ash4/482237_438321239576299_1000812544_n.jpg |
| 21:30.50 | Wormy | hah |
| 21:31.13 | Hachi_ | http://sphotos-c.ak.fbcdn.net/hphotos-ak-ash4/394683_526361414080790_1793235693_n.jpg Look Monet, a Krann! |
| 21:31.42 | Monet | What is this I don't even. |
| 21:31.44 | Xho | First picture made me squrim in many places |
| 21:31.53 | Wormy | its a kelpie |
| 21:31.55 | Cyrannian | http://spore.wikia.com/wiki/Fiction:Galactic_Empire_of_Cyrannus/Imperial_Senate#Notable_Members |
| 21:33.56 | Wormy | i will watch tv then return |
| 21:36.33 | Cyrannian | Goodbye, sparkle mice. |
| 21:36.38 | Monet | A lot of women in the senate |
| 21:37.00 | *** join/#sporewiki Technobliterator (1f3566f6@gateway/web/freenode/ip.31.53.102.246) |
| 21:37.14 | Zmr56 | Hi |
| 21:37.21 | Technobliterator | hii |
| 21:42.36 | *** join/#sporewiki Tek__ (ae715610@gateway/web/qwebirc/irc.wikia.com/ip.174.113.86.16) |
| 21:42.45 | Hachi_ | https://www.youtube.com/watch?v=0itOCgJtNVU "This is what Martin Luther King Jr. sang at birthday parties" |
| 21:42.54 | Tek__ | Hello. |
| 21:43.22 | Tek__ | How do you change your IRC name? |
| 21:43.32 | Tek__ | ~nick Tek0516 |
| 21:43.33 | OfficerJackal | Type /nick |
| 21:44.01 | Tek0516 | Thank you. |
| 21:44.09 | Zmr56 | hi |
| 21:45.26 | Xho | Wow |
| 21:45.35 | Xho | Wikia finally allowed me to change my profile picture |
| 21:46.25 | Tek0516 | I'm guessing it went down along with a bunch of other stuff a while ago? |
| 21:46.32 | Xho | Yeah |
| 21:46.38 | Xho | I changed my profile name |
| 21:46.42 | Xho | I dunno how long ago now |
| 21:47.17 | Tek0516 | I might go change mine, remove a few numbers. |
| 21:47.53 | Hachi_ | http://sphotos-e.ak.fbcdn.net/hphotos-ak-ash3/535462_622584817758793_673784634_n.jpg |
| 21:48.08 | Tek0516 | "Tek" is already in use on IRC, so can't just remove the numbers. |
| 21:48.33 | Tek0516 | lol Hachi. |
| 21:50.21 | Tek0516 | So apparently we have some animal in our ceiling. (Attic may be correct term, but it's not really) |
| 21:56.33 | Xho | Hachi_: http://www.youtube.com/watch?v=UU63P50ag0c Say goodbye to logic |
| 21:56.37 | Hachi_ | Xho: http://www.youtube.com/watch?v=_ykbVt1ZaJM |
| 21:57.53 | Hachi_ | Is it wrong that I like Lady Gaga + Meshuggah? |
| 21:58.04 | Xho | Yes |
| 21:58.55 | Xho | ded |
| 21:59.06 | Hachi_ | nu |
| 21:59.10 | Hachi_ | stay dafuk here |
| 21:59.53 | Tek0516 | ... |
| 22:03.41 | Hachi_ | NO. |
| 22:03.58 | OfficerJackal | YOU JUST GOT PING'D! |
| 22:04.08 | OfficerJackal | *Punk'd music plays.* |
| 22:04.56 | Zmr56 | Victim of ping |
| 22:05.05 | Zmr56 | Horrible crime |
| 22:14.31 | Zmr56 | nngh, I wanted to join in Tatummodo Mortem, never got a reply :| |
| 22:14.45 | Zmr56 | dum |
| 22:14.49 | Zmr56 | saying this now |
| 22:17.04 | Hachi_ | We kinda already set the thing out |
| 22:17.12 | Zmr56 | nuu |
| 22:17.52 | Zmr56 | test |
| 22:17.54 | Monet | maybe we get stories from two fronts? |
| 22:17.56 | Zmr56 | oh |
| 22:17.59 | Zmr56 | nngh |
| 22:18.12 | Monet | BTW, http://spore.wikia.com/wiki/Fiction:Realities_Altered/Paragon%27s_Descent#Botanical_Comforts this is a gap-filler story. |
| 22:18.18 | Zmr56 | I thought IRC was being dum for a moment there |
| 22:27.39 | OfficerJackal | ~test |
| 22:27.39 | infobot | ACTION hunts officerjackal down and lays eggs in his digestive system |
| 22:28.05 | Zmr56 | out hatch |
| 22:28.11 | Zmr56 | Xeno_Bot |
| 22:28.34 | Zmr56 | ~digest OfficerJackal |
| 22:28.43 | Zmr56 | ~u dum |
| 22:30.20 | Aeon | ~digest me |
| 22:30.35 | Aeon | there is no "digest" thing |
| 22:31.42 | Zmr56 | Infobot never eats |
| 22:31.57 | Zmr56 | It's missing out on the fun |
| 22:38.02 | Wormy_away | it happened again today http://www.thehour.com/news/darien/man-killed-by-train-in-darien-identified/article_efbe8fb8-84c8-11e2-ab67-001a4bcf6878.html |
| 22:38.47 | Wormy | Oh hang on thats America |
| 22:39.08 | Zmr56 | Bye now |
| 22:39.29 | Wormy | It happened though today |
| 22:39.34 | Tek0516 | Hi |
| 22:39.54 | Tek0516 | ~Tek0516 |
| 22:39.54 | infobot | i guess tek0516 is secretly me |
| 22:41.46 | Tek0516 | I noticed one of my ships looks like Atlantis in the Stargate series. |
| 22:42.40 | *** join/#sporewiki R17 (79362259@gateway/web/freenode/ip.121.54.34.89) |
| 22:42.56 | Tek0516 | hello. |
| 22:44.04 | Wormy | rl batman http://www.bbc.co.uk/news/uk-england-leeds-21654930 |
| 22:44.06 | OfficerJackal | Hey there! |
| 22:46.31 | Monet | Why is it these media-covered vigilantes all look out of shape? |
| 22:47.21 | Hachi_ | hur |
| 22:47.31 | Hachi_ | Not all superheroes have to be athletic |
| 22:47.34 | *** join/#sporewiki Wormy_ (d92a9ab0@gateway/web/freenode/ip.217.42.154.176) |
| 22:47.35 | Wormy_ | rl batman http://www.bbc.co.uk/news/uk-england-leeds-21654930 |
| 22:48.00 | Monet | Batman looks fat in that clip. |
| 22:49.02 | OfficerJackal | ~ping |
| 22:49.02 | infobot | ~pong |
| 22:49.06 | OfficerJackal | ~timeout |
| 22:49.06 | infobot | ACTION sullenly sits in the timeout chair in the corner for 5 minutes. |
| 22:49.11 | Wormy_ | He must have grown a beer belly |
| 22:50.07 | Monet | The muscle-chest part of the costume reminds me of Stan Smith: One of the few people I can think of with massive bicepts and 6-pack and a beer-belly. |
| 22:50.30 | Aeon | R17: this is why I hate grimdark http://tvtropes.org/pmwiki/pmwiki.php/Main/ShootTheShaggyDog |
| 22:52.34 | R17 | Like I give a shit |
| 22:52.57 | R17 | EVERYTHING is what makes Grimdark wonderfully awesome |
| 22:54.10 | Tek0516 | ~ping |
| 22:54.10 | infobot | ~pong |
| 22:54.20 | Tek0516 | ~pong |
| 22:54.20 | infobot | ~ping |
| 22:54.29 | Tek0516 | ~ping pong |
| 22:54.29 | infobot | pong pong |
| 22:54.57 | Tek0516 | ~pong ~ping |
| 22:54.58 | infobot | ~ping: PONG!!!!!!!!!!!!!!!!!! |
| 22:55.07 | Tek0516 | lol |
| 22:55.15 | Tek0516 | ~ping ~pong |
| 22:55.15 | infobot | pong ~pong |
| 22:57.13 | Hachi_ | Stop spamming the infobot |
| 22:57.27 | Tek0516 | ok. |
| 23:00.39 | Wormy_ | an interesting house with hidden cellars and moving walls http://www.bbc.co.uk/news/uk-england-devon-21661850 |
| 23:02.53 | Wormy_ | Touchscreen ‘that reacts even without touching’ http://www.bbc.co.uk/programmes/p015scm8 |
| 23:05.36 | *** join/#sporewiki R17 (79362259@gateway/web/freenode/ip.121.54.34.89) |
| 23:05.56 | Tek0516 | quit and join? |
| 23:06.15 | R17 | wut |
| 23:07.32 | Tek0516 | you timed out right before you rejoined. |
| 23:07.41 | R17 | I know |
| 23:07.48 | R17 | I had to restart my computer |
| 23:09.23 | *** join/#sporewiki Cyrannian (6d4cdfd7@gateway/web/freenode/ip.109.76.223.215) |
| 23:09.23 | *** mode/#sporewiki [+o Cyrannian] by ChanServ |
| 23:09.41 | Cyrannian | HEllo! |
| 23:10.04 | R17 | Hurro |
| 23:13.06 | Tek0516 | Hello. |
| 23:17.10 | *** join/#sporewiki Wormy (d92a9ab0@gateway/web/freenode/ip.217.42.154.176) |
| 23:17.13 | Wormy | [Star Trek TNG] Ready Room Wrestlin' http://www.youtube.com/watch?v=SrKNbqrgyWE |
| 23:21.18 | Wormy | Monet: Erm Monet, my Steam is Offline. How do I get it online? |
| 23:23.15 | Monet | Right-click your icon in the main steam programe (bottom-right corner for me), and in the drop down menu should be an 'online' selection. |
| 23:24.08 | Wormy | ah thanks |
| 23:25.32 | Hachi_ | http://i3.kym-cdn.com/photos/images/newsfeed/000/278/761/0b5.gif |
| 23:29.44 | Wormy | Lol must be dragging his arse across the rug |
| 23:35.19 | Wormy | Oluap would love this http://www.youtube.com/watch?v=pacSXkv5G1o |
| 23:38.37 | Wormy | OMG this is funny http://www.youtube.com/watch?v=_hIVjPsF-y4 |
| 23:39.31 | Monet | I remember the video that came from. |
| 23:39.40 | Wormy | "These BEES are such assholes" |
| 23:41.03 | Monet | No joke. They played a game starring Bear Grylls and most of the animals you meet try to bite your manhood. |
| 23:43.07 | Wormy | Man vs. Wild game? |
| 23:43.58 | Monet | Yeah. |
